| comments are indicated by the | character. | check for warnings at the end of the header section. Holland & Powell '02 + Klemme et al '09 + Ziberna et al '13 => data base name |<= data base title begin_standard_variables |<= name (<9 characters), reference value, tolerance P(bar) 1.00 0.1E-3 T(K) 298.15 0.1E-4 Y(CO2) 0.00 0.1E-6 mu(C1) 0.00 0.1E-2 mu(C2) 0.00 0.1E-2 end_standard_variables tolerance -.1E-2 |<= DTOL for unconstrained minimization, energy units begin_components |<= name (<5 characters), molar weight (g) NA2O 61.9790 MGO 40.3040 AL2O3 101.9610 SIO2 60.0840 K2O 94.1960 CAO 56.0770 TIO2 79.8660 MNO 70.9370 FEO 71.8440 NIO 74.6930 CR2O3 151.9900 CL2 70.9060 O2 31.9990 H2O 18.0150 CO2 44.0100 end_components begin_special_components H2O CO2 end_special_components CHECK WARNINGS BELOW!!! begin_makes | the make definitions segment of the thermodynamic | data file is preceded by the "begin_makes" keyword, | and terminated by the "end_makes" keyword. Within | this segment comments must be preceded by a "|" | character. | the make definitions define new thermodynamic entities | (e.g., fO2 buffers, endmembers etc) as a linear combination of | the "real" entities in the thermodynamic file. the definition | includes a "DQF" correction that is used to increment the | G of the linearly combined G's as a function of pressure and | temperature, i.e., the total G computed for a made entity is | the G of the right-hand-side of the make reaction + Gdqf. | the format assumes data on one line of less than 240 characters, | the expected format is | name = num_1 * name_1 + num_2 * name_2 ....+ num_int * name_int | dnum_1 dnum_2 dnum_3 | where i num_j is a number or fraction (i.e., two numbers separated | by a '/') and name_j are the names of the j existing entities. | and the dqf correction to the entity 'name' is | Gdqf(J/mol) = dnum_1 + T[K]*dnum_2 + P[bar]*dnum_3 | made entities are excluded from calculations in vertex if they | are included in the excluded phase list in the computational option | file (e.g., "in"); however, real entities to the right of the equals | sign in a make definition are not effected by the excluded phase list. | for example, if qL (liquid silica) is excluded, the make defintion | q8L = 4 qL | will function, but qL will not be considered as a possible phase in | the vertex calculation. | kyco silica buffer | kyco = 1 ky - 1 cor | 0 0 0 | sphene + cc + ru + q CO2 buffer | tcrq = 1 cc + 1 ru + 1 q - 1 sph | 0. 0. 0. | Ti phengite endmember for Auzanneau et al. (CMP 159:1-24, 2010) mica model | Gdqf corrected from -482876. to -13469.8 J/mol, D. Dolejs, Mar 6, 2010. | tip = 1 fcel + 1 geik - 1/2 fs | -13469.8 -14.694 .84 | mthm = 6 hem - 4 mt | mthm O2 buffer | 0 0 0 | qfm = 2 mt + 3 q -3 fa | qfm O2 buffer | 0 0 0 |emog = -1 fo - 2 gph + 1 mag + 1/2 en | EMOG O2 buffer |0 0 0 |ffm = -6 fa + 3 fs + 2 mt | ffm O2 buffer |0 0 0 |fff = 2 fa - 2 iron - 1 fs | iron fa fs O2 buffer |0 0 0 tbi = 1 phl - 1 fo + 1 ru + 1 q | Ti-biotite endmember for TiBio(HP) model 45e3 0 0 | tbi1 = 1 phl - 1 br + 1 ru | Ti-biotite endmember for TiBio(WPH) model | 78e3 0 0 | L Tajcamanova, 5/11/2006. | fbi = 1 east - 1/2 cor + 1/2 hem | Fe3+-biotite endmember for TiBio(WPH) model, definition corrected for | | presumed typo in the WPH (JMG, 2007) paper by L Tajcamanova, 5/11/2007. | 13.45e3 0 0 | fbi = 1 east - 1/2 cor + 1 hem, 8/10/2007, L Tajcamanova | Fe endmembers for ultramafic mineral solution | models, based on the talc Fe-Mg exchange. fbr = 1 br - 1/3 ta + 1/3 fta 0 0 0 fchum = 1 chum - 3 ta + 3 fta 0 0 0 fphA = 1 phA - 7/3 ta + 7/3 fta 0 0 0 fper = 1 per - 1/3 ta + 1/3 fta 0 0 0 fatg = 1 atg - 16 ta + 16 fta 0 0 0 | odo = 1/2 mag + 1/2 cc | ordered dolmite species for H&P dolomite model | -13.5d3 0 0 |-------------------------------------------------------------------------------- | Generic 8-oxygen HP liquid endmembers. Because | these occur in many melts models they are created | here with a nominal DQF, the true model specific | DQF must be added in the solution model. JADC 2/2024 sil8L = 8/5 silL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember fo8L = 2 foL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember fa8L = 2 faL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember q8L = 4 qL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember wi8L = 2 wiL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember |-------------------------------------------------------------------------------- | endmembers for Green et al (2007) omph model, ds5 databases acm_dqf = 1 acm DQF(J/mol) = -4000 | endmembers for the Diener et al. (JMG, 2007) amphibole models mrb = 1 gl - 2 jd +2 acm | magnesioriebekite, stoichiometry corrected 3/30/08 JADC DQF(J/mol) = 8d3 ts_dqf = 1 ts | tschermakite DQF(J/mol) = 10000 parg_dqf = 1 parg | pargasite, Corrected from 10 kJ, 10/14/11, JADC DQF(J/mol) = 15000 gl_dqf = 1 gl | glaucophane, Corrected from 15 kJ, 10/14/11, MJC DQF(J/mol) = 3000 mpa = 1 parg -1 tr +1 anth | ortho-pargasite, stoichiometry corrected 3/30/08 JADC DQF(J/mol) = 27d3 ged_dqf = 1 ged | gedrite DQF(J/mol) = 22000 ogl_dqf = 1 gl | ortho-glaucophane DQF(J/mol) = 15000 fanth_dq = 1 fanth | ferro-anthophyllite DQF(J/mol) = 7000 omrb_dqf = 1 gl -2 jd +2 acm | ortho-magnesio riebekite (mrb dqf + 25000 J/mol), stoichiometry corrected 3/30/08 JADC DQF(J/mol) = 33000 cumm_dqf = 1 cumm DQF(J/mol) = -6400 grun_dqf = 1 grun DQF(J/mol) = -5000 | make definition for coma of the unpublished | thermocalc scapolite model coma = 3 ab + 1 cc 25000. 0. 0. | titano-clinohumite to fit weiss experiments. JADC, 2/08. | tichum = 4 fo + 1/2 br + 1/2 ru | -33581. 32. 0. tbit = 1 phl - 1 br + 1 ru |Ti-Fe3+ Biotite after Tajcmanova et al. (2009) 84e3 -11.5 0 |Model entered by Lucie Tajcmanova, September, 2008. fbit = 1 east - 1/2 cor + 1/2 hem |Ti-Fe3+ Biotite after Tajcmanova et al. (2009) 6e3 0 0 | Make definitions for the Smye et al (JMG, 2011, 28:753-768) | models for Mica, Carpholite and Chloritoid, to use these | make definitions delete the leading "|" comment characters: ocar = 1 fcar + 1/2 hem - 1/2 cor 45d3 0 0 mncar = 1 mcar + 1 mang - 1 per | corrected from 1 mcar + 1 mang - 1/2 cor, G Hoschek, 10/24/11. 30d3 0 0 octd = 1 fctd + 1/4 hem - 1/4 cor 125d2 0 0 fmu = 1 mu + 1/2 hem - 1/2 cor 30d3 0 0 | corrected from -30 kJ/mol, G Hoschek, 10/24/11. ma_dqf = 1 ma 3d3 0 0 | Make definition for the White et al (JMG, 2005) garnet, Gt(WPPH), JADC, 10/24/11. kho = 1 py - 1 gr + 1 andr 40d3 0 0 | Make definitions for the White et al (JMG, 2000) ilmenite, Ilm(WHP), JADC, 10/29/11. | Corrected coeffiecients for TC un-landau, formerly, the TC DQF was used without | modification. NOTE: the ilm and ilm_nol endmembers must be excluded from calculations | with the Ilm(WPH) model and the ilm_nol, oilm and dilm must be excluded from calculations | without the Ilm(WPH) model. JADC, 6/19/11. dilm = 1 ilm_nol | 1993 -2.1 0 => the TC DQF coeffecients, the values below are | oilm + {DH,R*ln(4),0} 15789.27763 -12.19977769 .1836386612d-1 | Make definitions for Kelsey & Powell (JMG, 2011) Zr melting relations. JADC, 2/6/12 zr8L = 2 zrc | Zr-melt endmember 69e3 0 0 zrg = 1 gr + 3 zrc - 6 q | Zr garnet endmember 96e3 0.165e3 2.7 zrru = 1 bdy | Zr rutile endmember 52.84e3 -0.01829e3 -0.074 mots = 1 mgts - 1/2 cor + 1/2 hem | ferric opx endmember MgFe3+AlSiO6 for Opx(HP) 22d3 0 0 esn = 1 cats - 1/2 cor + 1/2 hem | essenite, ferric cpx endmember CaFe3+AlSiO6 for Cpx(HP) 22d3 0 0 fcrm_i = 1 herc + 1 mcrm - 1 sp | dependent emdmember from the CrSp solution model 0. 0. 0. end_makes data modified as described in ziberna et al (2013, CMP) This version of hp02ver.dat contains Cr endmembers created and/or added for the calculation of upper mantle phase relations at the PGP workshop April 10-12, 2006; see folk.uio.no/ninasim/Cr_results.html or Klemme et al (2009, lithos). To avoid reformatting the data file ZrO2 was replaced Cr2O3, necessitating the elimination of bdy (baddelyite) and zrn (zircon). JADC Apr 24, 2006. The Holland & Powell data base reproduced here has been augmented by shear moduli with sources as specified in Connolly & Kerrick EPSL '02 and Connolly EPSL '05. JADC Mar 9, 2004. The Thermocalc data base includes data for ionic aqueous species, this data can be used in PERPLEX but was not included to conserve space. To create a data base containing this data run the program HPTOVER and add the electron component. JADC Mar 9, 2002. th pdata produced at 16.35 on Wed 13 Feb,2002 (with sigma fit = 1.089) see comments in hp96ver.dat for additional information on changes from the earlier hp94ver.dat and hp90ver.dat files. comments can be written in the data file between entries, provided the first character of comment card is left blank. WARNINGS: 0) The Holland & Powell thermodynamic data herein has been augmented by data for the Ghiorso et al. (2002, G3) pMELTS model. These data are not necessarily consistent and results obtained using the mixed data sources should be viewed with caution. The Ghirso et al data consists of the following melt (liquid) endmembers: Name Composition qGL Si4O8 coGL Al4O6 faGL Fe2SiO4 foGL Mg2SiO4 woGL Ca2Si2O6 nasGL NaSi1/2O3/2 kalGL KAlSiO4 h2oGL H2O 1) The following names have been changed from the HP98 paper to maintain consistency with earlier perplex data file: HP98 PERPLEX fact ftr 2) The following linearly dependent endmembers have been DELETED from this version of the data base. fts = ts + 3/5 ftr - 3/5 tr fame = ames + 4/5 daph - 4/5 clin sdph = east + 2/3 ann - 2/3 phl ftat = tats + 2/3 fta - 2/3 ta fparg = parg + 4/5 ftr - 4/5 tr fgl = gl + 3/5 ftr - 3/5 tr hfcrd = hcrd + fcrd - crd fets = mgts + 1/2 fs - 1/2 en fafchl = afchl + 6/5 daph - 6/5 clin odo = 0.5 mag + 0.5 cc, G lowered This means that this data file cannot be used with old Perple_X solution model files. Notation (not alphabetical!) Entity Symbol Formula akermanite ak Ca2MgSi2O7 almandine alm Fe3Al2Si3O12 andalusite and Al2SiO5 andradite andr Ca3Fe2Si3O12 clinohumite chum Mg9Si4O16(OH)2 clinozoisite cz Ca2Al3Si3O12(OH) cordierite crd Mg2Al4Si5O18 epidote(ordered) ep Ca2FeAl2Si3O12(OH) fayalite fa Fe2SiO4 Fe-chloritoid fctd FeAl2SiO5(OH)2 Fe-cordierite fcrd Fe2Al4Si5O18 Fe-epidote fep Ca2Fe2AlSi3O12(OH) Fe-osumilite fosm KFe2Al5Si10O30 Fe-staurolite fst Fe4Al18Si7.5O48H4 forsterite fo Mg2SiO4 gehlenite geh Ca2Al2SiO7 grossular gr Ca3Al2Si3O12 hydrouscordierite hcrd Mg2Al4Si5O18›H2O hydroxy-topaz tpz Al2SiO4(OH)2 kyanite ky Al2SiO5 larnite-bredigite larn Ca2SiO4 lawsonite law CaAl2Si2O7(OH)2›H2O merwinite merw Ca3MgSi2O8 Mg-chloritoid mctd MgAl2SiO5(OH)2 Mg-staurolite mst Mg4Al18Si7.5O48H4 Mn-chloritoid mnctd MnAl2SiO5(OH)2 Mn-cordierite mncrd Mn2Al4Si5O18 Mn-staurolite mnst Mn4Al18Si7:5O48H4 monticellite mont CaMgSiO4 osumilite(1) osm1 KMg2Al5Si10O30 osumilite(2) osm2 KMg3Al3Si11O30 phase A phA Mg7Si2O8(OH)6 pumpellyite pump Ca4MgAl5Si6O21(OH)7 pyrope py Mg3Al2Si3O12 rankinite rnk Ca3Si2O7 sillimanite sill Al2SiO5 spessartine spss Mn3Al2Si3O12 sphene sph CaTiSiO5 spurrite spu Ca5Si2O8(CO3) tephroite teph Mn2SiO4 tilleyite ty Ca5Si2O7(CO3)2 vesuvianite vsv Ca19Mg2Al11Si18O69(OH)9 zircon zrc ZrSiO4 zoisite zo Ca2Al3Si3O12(OH) acmite acm NaFeSi2O6 Ca-tschermaks pyroxene cats CaAl2SiO6 Diopside di CaMgSi2O6 enstatite en Mg2Si2O6 ferrosilite fs Fe2Si2O6 hedenbergite hed CaFeSi2O6 jadeite jd NaAlSi2O6 mg-tschermak mgts MgAl2SiO6 pseudowollastonite pswo CaSiO3 pyroxmangite pxmn MnSiO3 rhodonite rhod MnSiO3 wollastonite wo CaSiO3 anthophyllite anth Mg7Si8O22(OH)2 cummingtonite cumm Mg7Si8O22(OH)2 Fe-anthophyllite fanth Fe7Si8O22(OH)2 Fe-glaucophane fgl Na2Fe3Al2Si8O22(OH)2 ferroactinolite ftr Ca2Fe5Si8O22(OH)2 gedrite(Na-free) ged Mg5Al4Si6O22(OH)2 glaucophane gl Na2Mg3Al2Si8O22(OH)2 grunerite grun Fe7Si8O22(OH)2 pargasite parg NaCa2Mg4Al3Si6O22(OH)2 riebeckite rieb Na2Fe5Si8O22(OH)2 tremolite tr Ca2Mg5Si8O22(OH)2 tschermakite ts Ca2Mg3Al4Si6O22(OH)2 deerite deer Fe18Si12O40(OH)10 fe-carpholite fcar FeAl2Si2O6(OH)4 fe-sapphirine(793) fspr Fe3.5Al9Si1.5O20 mg-carpholite mcar MgAl2Si2O6(OH)4 sapphirine(442) spr4 Mg4Al8Si2O20 sapphirine(793) spr7 Mg3.5Al9Si1.5O20 annite ann KFe3AlSi3O10(OH)2 celadonite cel KMgAlSi4O10(OH)2 eastonite east KMg2Al3Si2O10(OH)2 Fe-celadonite fcel KFeAlSi4O10(OH)2 margarite ma CaAl4Si2O10(OH)2 Mn-biotite mnbi KMn3AlSi3O10(OH)2 muscovite mu KAl3Si3O10(OH)2 Na-phlogopite naph NaMg3AlSi3O10(OH)2 paragonite pa NaAl3Si3O10(OH)2 phlogopite phl KMg3AlSi3O10(OH)2 Al-free chlorite afchl Mg6Si4O10(OH)4 amesite(14Ang) ames Mg4Al4Si2O10(OH)8 clinochlore(ordered) clin Mg5Al2Si3O10(OH)8 daphnite daph Fe5Al2Si3O10(OH)8 Fe-sudoite fsud Fe2Al4Si3O10(OH)8 Mn-chlorite mnchl Mn5Al2Si3O10(OH)8 Sudoite sud Mg2Al4Si3O10(OH)8 antigorite atg Mg48Si34O85(OH)62 chrysotile chr Mg3Si2O5(OH)2 Fe-talc fta Fe3Si4O10(OH)2 Kaolinite kao Al2Si2O5(OH)4 prehnite pre Ca2Al2Si3O10(OH)2 pyrophyllite prl Al2Si4O10(OH)2 talc ta Mg3Si4O10(OH)2 tschermak-talc tats Mg2Al2Si3O10(OH)2 albite ab NaAlSi3O8 analcite anl NaAlSi2O6›H2O anorthite an CaAl2Si2O8 coesite coe SiO2 cristobalite crst SiO2 heulandite heu CaAl2Si7O18›6H2O highalbite abh NaAlSi3O8 kalsilite kals KAlSiO4 laumontite lmt CaAl2Si4O12›4H2O leucite lc KAlSi2O6 meionite me Ca4Al6Si6O24(CO3) microcline mic KAlSi3O8 nepheline ne NaAlSiO4 quartz q SiO2 sanidine san KAlSi3O8 stilbite stlb CaAl2Si7O18›7H2O stishovite stv SiO2 tridymite trd SiO2 wairakite wrk CaAl2Si4O12›H2O3 baddeleyite bdy ZrO2 corundum cor Al2O3 geikielite geik MgTiO3 hematite hem Fe2O3 hercynite herc FeAl2O4 ilmenite ilm FeTiO3 lime lime CaO magnesioferrite mft MgFe2O4 magnetite mt Fe3O4 manganosite mang MnO nickel oxide NiO periclase per MgO pyrophanite pnt MnTiO3 rutile ru TiO2 spinel sp MgAl2O4 ulvospinel usp Fe2TiO4 brucite br Mg(OH)2 diaspore dsp AlO(OH) goethite gth FeO(OH) ankerite ank CaFe(CO3)2 aragonite arag CaCO3 calcite cc CaCO3 dolomite dol CaMg(CO3)2 magnesite mag MgCO3 rhodochrosite rhc MnCO3 siderite sid FeCO3 diamond diam C graphite gph C iron iron Fe nickel Ni Ni carbon dioxide CO2 carbon monoxide CO hydrogen H2 methane CH4 oxygen O2 water fluid H2O albite liquid abL NaAlSi3O8 anorthite liquid anL CaAl2Si2O8 diopside liquid diL CaMgSi2O6 enstatite liquid enL Mg2Si2O6 fayalite liquid faL Fe2SiO4 Fe-liquid (in KFMASH) fliq K3Fe0:5Al4Si19:5O47 Forsterite liquid foL Mg2SiO4 H2O liquid h2oL H2O H2O liquid (in KFMASH) hliq H2O K-feldspar liquid kspL KAlSi3O8 Mg liquid (in KFMASH) mliq K3Mg0:5Al4Si19:5O47 Silica liquid qL SiO2 Sillimanite liquid silL Al2SiO5 H+(aq) H+ Cl­(aq) Cl- OH­(aq) OH- Na+(aq) Na+ K+(aq) K+ Ca2+(aq) Ca++ Mg2+(aq) Mg++ Fe2+(aq) Fe++ Al3+(aq) Al+++ CO3--(aq) CO3 Al(OH)3(aq) AlOH3 Al(OH)4----(aq) AlOH4-KOH(aq) KOH HCl(aq) HCL KCl(aq) KCL NaCl(aq) NaCl CaCl(aq) CaCl2 CaCl+(aq) CaCl+ MgCl2(aq) MgCl2 MgCl+(aq) MgCl FeCl(aq) FeCl2 Aqueous silica aqSi SiO2 the following "end" card marks the end of the header section of the data file end fo EoS = 2 | H= -2172240. MGO(2)SIO2(1) G0 = -2053138 S0 = 95.1 V0 = 4.366 c1 = 233.3 c2 = .1494E-2 c3 = -603800 c5 = -1869.7 b1 = .613E-4 b5 = -.613E-3 b6 = 1250000. b7 = -187.5 b8 = 4 m0 = 810000 m1 = 1.82 m2 = -140 end fa EoS = 2 | H= -1478160. SIO2(1)FEO(2) G0 = -1378945 S0 = 151 V0 = 4.631 c1 = 201.1 c2 = .1733E-1 c3 = -1960600 c5 = -900.9 b1 = .505E-4 b5 = -.505E-3 b6 = 1330000. b7 = -199.5 b8 = 4 end teph EoS = 2 | H= -1732300. SIO2(1)MNO(2) G0 = -1631725 S0 = 155.9 V0 = 4.899 c1 = 219.6 c3 = -1292700 c5 = -1308.3 b1 = .505E-4 b5 = -.505E-3 b6 = 1200000. b7 = -180 b8 = 4 end lrn EoS = 2 | H= -2307160. SIO2(1)CAO(2) G0 = -2192411 S0 = 127.6 V0 = 5.16 c1 = 247.5 c2 = -.3206E-2 c5 = -2051.9 b1 = .505E-4 b5 = -.505E-3 b6 = 1200000. b7 = -180 b8 = 4 transition = 1 type = 4 t1 = 1710 t2 = 10.03 t3 = .5E-1 end mont EoS = 2 | H= -2252950. MGO(1)SIO2(1)CAO(1) G0 = -2135055 S0 = 108.1 V0 = 5.148 c1 = 250.7 c2 = -.10433E-1 c3 = -797200 c5 = -1996.1 b1 = .563E-4 b5 = -.563E-3 b6 = 1120000. b7 = -168 b8 = 4 end chum EoS = 2 | H= -9607380. MGO(9)SIO2(4)H2O(1) G0 = -9040340 S0 = 445 V0 = 19.785 c1 = 1070 c2 = -.16533E-1 c3 = -7899600 c5 = -7373.9 b1 = .61E-4 b5 = -.61E-3 b6 = 1290000. b7 = -193.5 b8 = 4 end py EoS = 2 | H= -6284750. py cpb is -4315.2 MGO(3)AL2O3(1)SIO2(3) G0 = -5934105 S0 = 266.3 V0 = 11.318 c1 = 633.5 c3 = -5196100 c5 = -4375.2 b1 = .436E-4 b5 = -.436E-3 b6 = 1737000. b7 = -260.55 b8 = 4 m0 = 926900 m1 = 1.47 m2 = -87 end alm EoS = 2 | H= -5263630. AL2O3(1)SIO2(3)FEO(3) G0 = -4939788 S0 = 340 V0 = 11.511 c1 = 677.3 c3 = -3772700 c5 = -5044 b1 = .403E-4 b5 = -.403E-3 b6 = 1690000. b7 = -253.5 b8 = 4 m0 = 955400 m1 = 1.4 m2 = -109 end spss EoS = 2 | H= -5646410. AL2O3(1)SIO2(3)MNO(3) G0 = -5326387 S0 = 367 V0 = 11.792 c1 = 584.6 c2 = -.1593E-2 c3 = -7516700 c5 = -2750.1 b1 = .462E-4 b5 = -.462E-3 b6 = 1790000. b7 = -268.5 b8 = 4 m0 = 955400 m1 = 1.4 m2 = -109 end gr EoS = 2 | H= -6644130. AL2O3(1)SIO2(3)CAO(3) G0 = -6282110 S0 = 255 V0 = 12.535 c1 = 626 c3 = -5779200 c5 = -4002.9 b1 = .393E-4 b5 = -.393E-3 b6 = 1680000. b7 = -252 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end andr EoS = 2 | H= -5768250. SIO2(3)CAO(3)FEO(2)O2(.5) G0 = -5425652 S0 = 318 V0 = 13.204 c1 = 638.6 c3 = -4955100 c5 = -3989.2 b1 = .393E-4 b5 = -.393E-3 b6 = 1590000. b7 = -238.5 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end osm1 EoS = 2 | H= -.1496858E8 MGO(2)AL2O3(2.5)SIO2(10)K2O(.5) G0 = -14122760 S0 = 701 V0 = 37.893 c1 = 1625.8 c2 = -.35548E-1 c3 = -8063500 c5 = -13490.9 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end osm2 EoS = 2 | H= -.1481075E8 MGO(3)AL2O3(1.5)SIO2(11)K2O(.5) G0 = -13973340 S0 = 724 V0 = 38.44 c1 = 1610.6 c2 = -.34457E-1 c3 = -8262099 c5 = -13128.8 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end fosm EoS = 2 | H= -.1424892E8 AL2O3(2.5)SIO2(10)K2O(.5)FEO(2) G0 = -13424510 S0 = 762 V0 = 38.32 c1 = 1656 c2 = -.34163E-1 c3 = -6497700 c5 = -14114.3 b1 = .8E-5 b5 = -.8E-4 b6 = 800000 b7 = -120 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end vsv EoS = 2 | H= -.4235251E8 MGO(2)AL2O3(5.5)SIO2(18)CAO(19)H2O(4.5) G0 = -39905380 S0 = 1890 V0 = 85.2 c1 = 4488 c2 = -.57952E-1 c3 = -22269300 c5 = -33478 b1 = .5E-4 b5 = -.5E-3 b6 = 1670000. b7 = -250.5 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end and EoS = 2 | H= -2588750. AL2O3(1)SIO2(1) G0 = -2440924 S0 = 92.7 V0 = 5.153 c1 = 277.3 c2 = -.6588E-2 c3 = -1914100 c5 = -2265.6 b1 = .411E-4 b5 = -.411E-3 b6 = 1334000. b7 = -200.1 b8 = 4 m0 = 1070000 m1 = 1.6 m2 = -120 end ky EoS = 2 | H= -2593110. AL2O3(1)SIO2(1) G0 = -2442541 S0 = 83.5 V0 = 4.414 c1 = 279.4 c2 = -.7124E-2 c3 = -2055600 c5 = -2289.4 b1 = .404E-4 b5 = -.404E-3 b6 = 1590000. b7 = -238.5 b8 = 4 m0 = 966000 m1 = 2 m2 = -15 end sill EoS = 2 | H= -2585860. AL2O3(1)SIO2(1) G0 = -2438869 S0 = 95.5 V0 = 4.986 c1 = 280.2 c2 = -.69E-2 c3 = -1375700 c5 = -2399.4 b1 = .221E-4 b5 = -.221E-3 b6 = 1320000. b7 = -198 b8 = 4 m0 = 929000 m1 = 2 m2 = -15 transition = 1 type = 4 t1 = 2200 t2 = 4 t3 = .35E-1 end tpz EoS = 2 | H= -2904980. AL2O3(1)SIO2(1)H2O(1) G0 = -2689921 S0 = 100.5 V0 = 5.339 c1 = 387.7 c2 = -.712E-2 c3 = -857200 c5 = -3744.2 b1 = .404E-4 b5 = -.404E-3 b6 = 1315000. b7 = -197.25 b8 = 4 m0 = 966000 m1 = 2 m2 = -15 end mst EoS = 2 | H= -.2510146E8 MGO(4)AL2O3(9)SIO2(7.5)H2O(2) G0 = -23593330 S0 = 910 V0 = 44.26 c1 = 2820.5 c2 = -.59366E-1 c3 = -13774000 c5 = -24126 b1 = .12E-4 b5 = -.12E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end fst EoS = 2 | H= -.2375423E8 AL2O3(9)SIO2(7.5)FEO(4)H2O(2) G0 = -22282350 S0 = 1010 V0 = 44.88 c1 = 2880 c2 = -.56595E-1 c3 = -10642000 c5 = -25373 b1 = .12E-4 b5 = -.12E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end mnst EoS = 2 | H= -.2420382E8 AL2O3(9)SIO2(7.5)MNO(4)H2O(2) G0 = -22730480 S0 = 1024 V0 = 45.46 c1 = 2873.3 c2 = -.89064E-1 c3 = -12688000 c5 = -24749 b1 = .12E-4 b5 = -.12E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end mctd EoS = 2 | H= -3551430. MGO(1)AL2O3(1)SIO2(1)H2O(1) G0 = -3307815 S0 = 140 V0 = 6.875 c1 = 464.4 c2 = -.12654E-1 c3 = -1147200 c5 = -4341 b1 = .542E-4 b5 = -.542E-3 b6 = 1465000. b7 = -219.75 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end fctd EoS = 2 | H= -3215460. AL2O3(1)SIO2(1)FEO(1)H2O(1) G0 = -2977927 S0 = 155 V0 = 6.98 c1 = 484.6 c2 = -.13808E-1 c3 = -198900 c5 = -4762.2 b1 = .542E-4 b5 = -.542E-3 b6 = 1465000. b7 = -219.75 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end mnctd EoS = 2 | H= -3329280. AL2O3(1)SIO2(1)MNO(1)H2O(1) G0 = -3093616 S0 = 166 V0 = 7.175 c1 = 464.4 c2 = -.12654E-1 c3 = -1147200 c5 = -4341 b1 = .542E-4 b5 = -.542E-3 b6 = 1465000. b7 = -219.75 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end merw EoS = 2 | H= -4546260. MGO(1)SIO2(2)CAO(3) G0 = -4318804 S0 = 253.1 V0 = 9.847 c1 = 417.5 c2 = .8117E-2 c3 = -2923000 c5 = -2320.3 b1 = .615E-4 b5 = -.615E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end spu EoS = 2 | H= -5849370. SIO2(2)CAO(5)CO2(1) G0 = -5536279 S0 = 330 V0 = 14.697 c1 = 614.1 c2 = -.3508E-2 c3 = -2493100 c5 = -4168 b1 = .65E-4 b5 = -.65E-3 b6 = 950000 b7 = -142.5 b8 = 4 m0 = 575000 m1 = 2 m2 = -15 end zo EoS = 2 | H= -6898520. AL2O3(1.5)SIO2(3)CAO(2)H2O(.5) G0 = -6502908 S0 = 297 V0 = 13.575 c1 = 595.7 c2 = .62297E-1 c3 = -5921300 c5 = -3394.7 b1 = .67E-4 b5 = -.67E-3 b6 = 1120000. b7 = -168 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end cz EoS = 2 | H= -6898050. AL2O3(1.5)SIO2(3)CAO(2)H2O(.5) G0 = -6503630 S0 = 301 V0 = 13.63 c1 = 567 c2 = .18063E-1 c3 = -7034000 c5 = -2603 b1 = .46E-4 b5 = -.46E-3 b6 = 1120000. b7 = -168 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end fep EoS = 2 | H= -6002200. AL2O3(.5)SIO2(3)CAO(2)FEO(2)O2(.5)H2O(.5) G0 = -5625115 S0 = 357 V0 = 14.19 c1 = 520.1 c2 = .31499E-1 c3 = -15426000 c5 = 218.8 b1 = .505E-4 b5 = -.505E-3 b6 = 1294000. b7 = -194.1 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end ep EoS = 2 | H= -6463180. AL2O3(1)SIO2(3)CAO(2)FEO(1)O2(.25)H2O(.5) G0 = -6077129 S0 = 328 V0 = 13.91 c1 = 544.6 c2 = .24781E-1 c3 = -11230000 c5 = -1192.1 b1 = .505E-4 b5 = -.505E-3 b6 = 1233000. b7 = -184.95 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end law EoS = 2 | H= -4869070. AL2O3(1)SIO2(2)CAO(1)H2O(2) G0 = -4513272 S0 = 230 V0 = 10.132 c1 = 687.8 c2 = .1566E-2 c3 = 375900 c5 = -7179.2 b1 = .582E-4 b5 = -.582E-3 b6 = 1014000. b7 = -152.1 b8 = 4 m0 = 520000 m1 = .9613 m2 = -91 end pump EoS = 2 | H= -.143894E8 MGO(1)AL2O3(2.5)SIO2(6)CAO(4)H2O(3.5) G0 = -13448720 S0 = 629 V0 = 29.55 c1 = 1720.8 c2 = -.24928E-1 c3 = -5998700 c5 = -14620.3 b1 = .5E-4 b5 = -.5E-3 b6 = 1615000. b7 = -242.25 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end geh EoS = 2 | H= -3986850. AL2O3(1)SIO2(1)CAO(2) G0 = -3785608 S0 = 202 V0 = 9.024 c1 = 405.7 c2 = -.7099E-2 c3 = -1188300 c5 = -3174.4 b1 = .417E-4 b5 = -.417E-3 b6 = 1080000. b7 = -162 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 transition = 1 type = 4 t1 = 700 t2 = 11 t3 = .97E-1 end ak EoS = 2 | H= -3866300. MGO(1)SIO2(2)CAO(2) G0 = -3669742 S0 = 212.5 V0 = 9.254 c1 = 385.4 c2 = .3209E-2 c3 = -247500 c5 = -2889.9 b1 = .508E-4 b5 = -.508E-3 b6 = 1420000. b7 = -213 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end rnk EoS = 2 | H= -3944440. SIO2(2)CAO(3) G0 = -3744468 S0 = 210 V0 = 9.651 c1 = 372.3 c2 = -.2893E-2 c3 = -2462400 c5 = -2181.3 b1 = .65E-4 b5 = -.65E-3 b6 = 950000 b7 = -142.5 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end ty EoS = 2 | H= -6368190. SIO2(2)CAO(5)CO2(2) G0 = -6010097 S0 = 390 V0 = 17.039 c1 = 741.7 c2 = -.5345E-2 c3 = -1434600 c5 = -5878.5 b1 = .65E-4 b5 = -.65E-3 b6 = 950000 b7 = -142.5 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end crd EoS = 2 | H= -9163560. MGO(2)AL2O3(2)SIO2(5) G0 = -8653094 S0 = 407.5 V0 = 23.322 c1 = 821.3 c2 = .43339E-1 c3 = -8211200 c5 = -5000 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 m0 = 810000 m1 = 1.82 m2 = -140 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end hcrd EoS = 2 | H= -9447170. MGO(2)AL2O3(2)SIO2(5)H2O(1) G0 = -8890938 S0 = 487.3 V0 = 23.322 c1 = 869.7 c2 = .51995E-1 c3 = -7723700 c5 = -5251.2 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 m0 = 810000 m1 = 1.82 m2 = -140 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end fcrd EoS = 2 | H= -8436360. AL2O3(2)SIO2(5)FEO(2) G0 = -7949239 S0 = 475 V0 = 23.71 c1 = 851.5 c2 = .44724E-1 c3 = -6645000 c5 = -5623.4 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 m0 = 810000 m1 = 1.82 m2 = -140 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end mncrd EoS = 2 | H= -8681360. AL2O3(2)SIO2(5)MNO(2) G0 = -8191419 S0 = 475 V0 = 24.027 c1 = 847.7 c2 = .2849E-1 c3 = -7668200 c5 = -5311.4 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 m0 = 810000 m1 = 1.82 m2 = -140 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end phA EoS = 2 |H= -7130190. MGO(7)SIO2(2)H2O(3) G0 = -6609954 S0 = 350 V0 = 15.442 c1 = 964 c2 = -.11521E-1 c3 = -4517800 c5 = -7724.7 b1 = .826E-4 b5 = -.826E-3 b6 = 1450000. b7 = -217.5 b8 = 4 m0 = 226000 m1 = 3.53 m2 = -104.8 end sph EoS = 2 | H= -2595490. SIO2(1)CAO(1)TIO2(1) G0 = -2454504 S0 = 131.2 V0 = 5.565 c1 = 233.7 c2 = .4043E-2 c3 = -2306500 c5 = -1207.6 b1 = .42E-4 b5 = -.42E-3 b6 = 1100000. b7 = -165 b8 = 4 m0 = 1121400 m1 = .78 m2 = -21 end en EoS = 2 | H= -3090500. MGO(2)SIO2(2) G0 = -2915760 S0 = 132.5 V0 = 6.262 c1 = 356.2 c2 = -.299E-2 c3 = -596900 c5 = -3185.3 b1 = .505E-4 b5 = -.505E-3 b6 = 1070000. b7 = -160.5 b8 = 4 m0 = 757000 m1 = 1.5 m2 = -115 end | 0.757e6 2.0 -90. 0. 0. 0. 0. 0. 0. 0. => C/K values fs EoS = 2 | H= -2388650. SIO2(2)FEO(2) G0 = -2234453 S0 = 190.6 V0 = 6.592 c1 = 398.7 c2 = -.6579E-2 c3 = 1290100 c5 = -4058 b1 = .632E-4 b5 = -.632E-3 b6 = 1010000. b7 = -151.5 b8 = 4 m0 = 514000 m1 = 1.5 m2 = -115 end | 0.514e6 2.0 -90. 0. 0. 0. 0. 0. 0. 0. => C/K values mgts EoS = 2 | H= -3189350. original -3012610. 131. MGO(1)AL2O3(1)SIO2(1) G0 = -3012610 S0 = 131 V0 = 5.9 c1 = 371.4 c2 = -.4082E-2 c3 = -398400 c5 = -3547.1 b1 = .508E-4 b5 = -.508E-3 b6 = 1143999. b7 = -171.6 b8 = 4 m0 = 757000 m1 = 1.5 m2 = -115 end di EoS = 2 | H= -3202720. MGO(1)SIO2(2)CAO(1) G0 = -3028353 S0 = 142.7 V0 = 6.619 c1 = 314.5 c2 = .41E-4 c3 = -2745900 c5 = -2020.1 b1 = .57E-4 b5 = -.57E-3 b6 = 1223000. b7 = -183.45 b8 = 4 m0 = 670000 m1 = 1.7 m2 = -100 end hed EoS = 2 | H= -2844360. SIO2(2)CAO(1)FEO(1) G0 = -2680995 S0 = 174.2 V0 = 6.795 c1 = 340.2 c2 = .812E-3 c3 = -1047800 c5 = -2646.7 b1 = .57E-4 b5 = -.57E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 610000 m1 = 1.7 m2 = -100 end jd EoS = 2 | H= -3027850. NA2O(.5)AL2O3(.5)SIO2(2) G0 = -2849148 S0 = 133.5 V0 = 6.04 c1 = 301.1 c2 = .10143E-1 c3 = -2239300 c5 = -2055.1 b1 = .466E-4 b5 = -.466E-3 b6 = 1284000. b7 = -192.6 b8 = 4 m0 = 840000 m1 = 1.7 m2 = -130 end acm EoS = 2 | H= -2586610. NA2O(.5)SIO2(2)FEO(1)O2(.25) G0 = -2419288 S0 = 170.6 V0 = 6.459 c1 = 307.1 c2 = .16758E-1 c3 = -1685500 c5 = -2125.8 b1 = .466E-4 b5 = -.466E-3 b6 = 1060000. b7 = -159 b8 = 4 m0 = 580000 m1 = 2 m2 = -10 end cats EoS = 2 | H= -3307000. original -3129678. 138. AL2O3(1)SIO2(1)CAO(1) G0 = -3131678 S0 = 138 V0 = 6.356 c1 = 347.6 c2 = -.6974E-2 c3 = -1781600 c5 = -2757.5 b1 = .443E-4 b5 = -.443E-3 b6 = 1140000. b7 = -171 b8 = 4 m0 = 740000 m1 = 2 m2 = -20 end rhod EoS = 2 | H= -1321760. SIO2(1)MNO(1) G0 = -1244801 S0 = 100.5 V0 = 3.494 c1 = 138.4 c2 = .4088E-2 c3 = -1936000 c5 = -538.9 b1 = .508E-4 b5 = -.508E-3 b6 = 1250000. b7 = -187.5 b8 = 4 m0 = 740000 m1 = 2 m2 = -20 end pxmn EoS = 2 | H= -1322540. SIO2(1)MNO(1) G0 = -1245224 S0 = 99.3 V0 = 3.472 c1 = 138.4 c2 = .4088E-2 c3 = -1936000 c5 = -538.9 b1 = .508E-4 b5 = -.508E-3 b6 = 1250000. b7 = -187.5 b8 = 4 m0 = 740000 m1 = 2 m2 = -20 end wo EoS = 2 | H= -1634110. SIO2(1)CAO(1) G0 = -1548917 S0 = 82.5 V0 = 3.993 c1 = 159.3 c3 = -967300 c5 = -1075.4 b1 = .46E-4 b5 = -.46E-3 b6 = 795000 b7 = -119.25 b8 = 4 m0 = 620000 m1 = 1.7 m2 = -100 end pswo EoS = 2 | H= -1627740. SIO2(1)CAO(1) G0 = -1544246 S0 = 88.2 V0 = 4.008 c1 = 157.8 c3 = -967300 c5 = -1075.4 b1 = .539E-4 b5 = -.539E-3 b6 = 1050000. b7 = -157.5 b8 = 4 m0 = 620000 m1 = 1.7 m2 = -100 end tr EoS = 2 | H= -.1231023E8 MGO(5)SIO2(8)CAO(2)H2O(1) G0 = -11582670 S0 = 550 V0 = 27.27 c1 = 1260.2 c2 = .383E-2 c3 = -11455000 c5 = -8237.601 b1 = .534E-4 b5 = -.534E-3 b6 = 762000.1 b7 = -114.3 b8 = 4 m0 = 617000 m1 = 1.19757 m2 = -96 end ftr EoS = 2 | H= -.1050391E8 SIO2(8)CAO(2)FEO(5)H2O(1) G0 = -9833597 S0 = 715 V0 = 28.28 c1 = 1290 c2 = .29991E-1 c3 = -8447500 c5 = -8947 b1 = .534E-4 b5 = -.534E-3 b6 = 760000 b7 = -114 b8 = 4 m0 = 617000 m1 = 1.19757 m2 = -96 end ts EoS = 2 | H= -.1254101E8 MGO(3)AL2O3(2)SIO2(6)CAO(2)H2O(1) G0 = -11808850 S0 = 545 V0 = 26.8 c1 = 1244.8 c2 = .24348E-1 c3 = -11965000 c5 = -8112.1 b1 = .534E-4 b5 = -.534E-3 b6 = 760000 b7 = -114 b8 = 4 m0 = 524500 m1 = 1.012085 m2 = -81.5 end parg EoS = 2 | H= -.127206E8 NA2O(.5)MGO(4)AL2O3(1.5)SIO2(6)CAO(2)H2O(1) G0 = -11988550 S0 = 601 V0 = 27.19 c1 = 1280.2 c2 = .22997E-1 c3 = -12359500 c5 = -8065.8 b1 = .534E-4 b5 = -.534E-3 b6 = 912000 b7 = -136.8 b8 = 4 m0 = 432000 m1 = .8266 m2 = -67 end gl EoS = 2 | H= -.1196964E8 NA2O(1)MGO(3)AL2O3(1)SIO2(8)H2O(1) G0 = -11234430 S0 = 535 V0 = 26.05 c1 = 1717.5 c2 = -.12107 c3 = 7075000 c5 = -19272 b1 = .53E-4 b5 = -.53E-3 b6 = 882999.9 b7 = -132.45 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end fgl EoS = 2 | H= -.1089164E8 NA2O(1)AL2O3(1)SIO2(8)FEO(3)H2O(1) G0 = -10187790 S0 = 624 V0 = 26.59 c1 = 1762.9 c2 = -.118992 c3 = 9423700 c5 = -20207.1 b1 = .53E-4 b5 = -.53E-3 b6 = 890000 b7 = -133.5 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end rieb EoS = 2 | H= -.1003511E8 NA2O(1)SIO2(8)FEO(5)O2(.5)H2O(1) G0 = -9351875 S0 = 691 V0 = 27.49 c1 = 1746.9 c2 = -.113572 c3 = 9370300 c5 = -19468.7 b1 = .53E-4 b5 = -.53E-3 b6 = 890000 b7 = -133.5 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end anth EoS = 2 | H= -.1206926E8 MGO(7)SIO2(8)H2O(1) G0 = -11342860 S0 = 536 V0 = 26.54 c1 = 1277.3 c2 = .25825E-1 c3 = -9704600 c5 = -9074.7 b1 = .5E-4 b5 = -.5E-3 b6 = 700000.1 b7 = -105 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end fanth EoS = 2 | H= -9627250. SIO2(8)FEO(7)H2O(1) G0 = -8968476 S0 = 725 V0 = 27.87 c1 = 1383.1 c2 = .30669E-1 c3 = -4224700 c5 = -11257.6 b1 = .5E-4 b5 = -.5E-3 b6 = 700000.1 b7 = -105 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end cumm EoS = 2 | H= -.1205757E8 MGO(7)SIO2(8)H2O(1) G0 = -11332370 S0 = 540 V0 = 26.33 c1 = 1277.3 c2 = .25825E-1 c3 = -9704600 c5 = -9074.7 b1 = .5E-4 b5 = -.5E-3 b6 = 700000.1 b7 = -105 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end grun EoS = 2 | H= -9613260. SIO2(8)FEO(7)H2O(1) G0 = -8955976 S0 = 730 V0 = 27.84 c1 = 1383.1 c2 = .30669E-1 c3 = -4224700 c5 = -11257.6 b1 = .5E-4 b5 = -.5E-3 b6 = 648000 b7 = -97.2 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end ged EoS = 2 | H= -.1231988E8 MGO(5)AL2O3(2)SIO2(6)H2O(1) G0 = -11584120 S0 = 515 V0 = 25.8 c1 = 1307.7 c2 = .23642E-1 c3 = -9307400 c5 = -9799 b1 = .48E-4 b5 = -.48E-3 b6 = 770000 b7 = -115.5 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end spr4 EoS = 2 | H= -.1101977E8 MGO(4)AL2O3(4)SIO2(2) G0 = -10422240 S0 = 443 V0 = 19.905 c1 = 1160.3 c2 = -.24324E-1 c3 = -7706600 c5 = -8974.2 b1 = .49E-4 b5 = -.49E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end spr7 EoS = 2 | H= -.1106577E8 MGO(3.5)AL2O3(4.5)SIO2(1.5) G0 = -10468950 S0 = 448 V0 = 19.775 c1 = 1167.9 c2 = -.2487E-1 c3 = -7607300 c5 = -9155.3 b1 = .49E-4 b5 = -.49E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end fspr EoS = 2 | H= -9835830. AL2O3(4.5)SIO2(1.5)FEO(3.5) G0 = -9275354 S0 = 551 V0 = 20.391 c1 = 1257.8 c2 = -.22171E-1 c3 = -1664000 c5 = -11348.4 b1 = .49E-4 b5 = -.49E-3 b6 = 1200000. b7 = -180 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end mcar EoS = 2 | H= -4781270. MGO(1)AL2O3(1)SIO2(2)H2O(2) G0 = -4422178 S0 = 210 V0 = 10.59 c1 = 667.8 c2 = -.12559E-1 c3 = -1167100 c5 = -6440 b1 = .5E-4 b5 = -.5E-3 b6 = 525000 b7 = -78.75 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end fcar EoS = 2 | H= -4413440. AL2O3(1)SIO2(2)FEO(1)H2O(2) G0 = -4069375 S0 = 255 V0 = 10.69 c1 = 674.8 c2 = -.10092E-1 c3 = -715800 c5 = -6554.5 b1 = .5E-4 b5 = -.5E-3 b6 = 525000 b7 = -78.75 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end deer EoS = 2 | H= -.1834767E8 SIO2(12)FEO(18)O2(1.5)H2O(5) G0 = -16901570 S0 = 1650 V0 = 55.74 c1 = 3164.4 c2 = -.27883E-1 c3 = -5039100 c5 = -26721 b1 = .5E-4 b5 = -.5E-3 b6 = 630000 b7 = -94.5 b8 = 4 m0 = 696000 m1 = 1.20833 m2 = -94 end mu EoS = 2 | H= -5984180. AL2O3(1.5)SIO2(3)K2O(.5)H2O(1) G0 = -5603722 S0 = 292 V0 = 14.083 c1 = 756.4 c2 = -.1984E-1 c3 = -2170000 c5 = -6979.2 b1 = .596E-4 b5 = -.596E-3 b6 = 490000 b7 = -73.5 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end cel EoS = 2 | H= -5842450. MGO(1)AL2O3(.5)SIO2(4)K2O(.5)H2O(1) G0 = -5462950 S0 = 290 V0 = 13.957 c1 = 741.2 c2 = -.18748E-1 c3 = -2368800 c5 = -6616.9 b1 = .596E-4 b5 = -.596E-3 b6 = 700000.1 b7 = -105 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end fcel EoS = 2 | H= -5477590. AL2O3(.5)SIO2(4)K2O(.5)FEO(1)H2O(1) G0 = -5111327 S0 = 329 V0 = 14.07 c1 = 756.3 c2 = -.19147E-1 c3 = -1586100 c5 = -6928.7 b1 = .596E-4 b5 = -.596E-3 b6 = 700000.1 b7 = -105 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end pa EoS = 2 | H= -5946330. NA2O(.5)AL2O3(1.5)SIO2(3)H2O(1) G0 = -5565091 S0 = 276 V0 = 13.211 c1 = 803 c2 = -.3158E-1 c3 = 217000 c5 = -8151 b1 = .774E-4 b5 = -.774E-3 b6 = 550000 b7 = -82.5 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end ma EoS = 2 | H= -6241150. AL2O3(2)SIO2(2)CAO(1)H2O(1) G0 = -5857267 S0 = 267 V0 = 12.964 c1 = 744.4 c2 = -.168E-1 c3 = -2074400 c5 = -6783.2 b1 = .487E-4 b5 = -.487E-3 b6 = 1300000. b7 = -195 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end phl EoS = 2 | H= -6219210. MGO(3)AL2O3(.5)SIO2(3)K2O(.5)H2O(1) G0 = -5837160 S0 = 328 V0 = 14.964 c1 = 770.3 c2 = -.36939E-1 c3 = -2328900 c5 = -6531.6 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 m0 = 1095000 m1 = .7 m2 = -220 end ann EoS = 2 | H= -5151860. AL2O3(.5)SIO2(3)K2O(.5)FEO(3)H2O(1) G0 = -4801474 S0 = 418 V0 = 15.432 c1 = 815.7 c2 = -.34861E-1 c3 = 19800 c5 = -7466.7 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 m0 = 1095000 m1 = .7 m2 = -220 end mnbi EoS = 2 | H= -5462860. AL2O3(.5)SIO2(3)K2O(.5)MNO(3)H2O(1) G0 = -5112715 S0 = 433 V0 = 15.264 c1 = 809.9 c2 = -.59213E-1 c3 = -1514400 c5 = -6998.7 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 m0 = 1095000 m1 = .7 m2 = -220 end east EoS = 2 | H= -6338210. -5951625. MGO(2)AL2O3(1.5)SIO2(2)K2O(.5)H2O(1) G0 = -5951625 S0 = 318 V0 = 14.738 c1 = 785.5 c2 = -.38031E-1 c3 = -2130300 c5 = -6893.7 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 end naph EoS = 2 | H= -6172870. NA2O(.5)MGO(3)AL2O3(.5)SIO2(3)H2O(1) G0 = -5791828 S0 = 318 V0 = 14.45 c1 = 773.5 c2 = -.40229E-1 c3 = -2597900 c5 = -6512.6 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 m0 = 1095000 m1 = .7 m2 = -220 end clin EoS = 2 | H= -8912480. MGO(5)AL2O3(1)SIO2(3)H2O(4) G0 = -8251890 S0 = 430.5 V0 = 21.09 c1 = 1161.8 c2 = .10133E-1 c3 = -7657300 c5 = -9690.899 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end ames EoS = 2 | H= -9034470. MGO(4)AL2O3(2)SIO2(2)H2O(4) G0 = -8366214 S0 = 410 V0 = 20.52 c1 = 1177 c2 = .9041E-2 c3 = -7458700 c5 = -10053 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end afchl EoS = 2 | H= -8727500. MGO(6)SIO2(4)H2O(4) G0 = -8067718 S0 = 428 V0 = 21.66 c1 = 1146.6 c2 = .11225E-1 c3 = -7855900 c5 = -9328.8 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end daph EoS = 2 | H= -7135350. AL2O3(1)SIO2(3)FEO(5)H2O(4) G0 = -6522911 S0 = 565 V0 = 21.34 c1 = 1237.4 c2 = .13594E-1 c3 = -3743000 c5 = -11250 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end mnchl EoS = 2 | H= -7666560. AL2O3(1)SIO2(3)MNO(5)H2O(4) G0 = -7056014 S0 = 595 V0 = 22.59 c1 = 1227.8 c2 = -.2699E-1 c3 = -6299800 c5 = -10469.4 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end sud EoS = 2 | H= -8626230. MGO(2)AL2O3(2)SIO2(3)H2O(4) G0 = -7970064 S0 = 404 V0 = 20.3 c1 = 1436.1 c2 = -.48749E-1 c3 = -2748500 c5 = -13764 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end fsud EoS = 2 | H= -7904130. AL2O3(2)SIO2(3)FEO(2)H2O(4) G0 = -7268477 S0 = 462 V0 = 20.4 c1 = 1466.3 c2 = -.47365E-1 c3 = -1182800 c5 = -14388 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end prl EoS = 2 | H= -5640620. AL2O3(1)SIO2(4)H2O(1) G0 = -5266608 S0 = 239.4 V0 = 12.81 c1 = 784.5 c2 = -.42948E-1 c3 = 1251000 c5 = -8495.9 b1 = .75E-4 b5 = -.75E-3 b6 = 525000 b7 = -78.75 b8 = 4 m0 = 405000 m1 = 1.20881 m2 = -54 end ta EoS = 2 | H= -5897150. MGO(3)SIO2(4)H2O(1) G0 = -5516955 S0 = 260 V0 = 13.625 c1 = 622.2 c3 = -6385500 c5 = -3916.3 b1 = .37E-4 b5 = -.37E-3 b6 = 480000 b7 = -72 b8 = 4 m0 = 226000 m1 = 3.53 m2 = -104.8 end fta EoS = 2 | H= -4803160. SIO2(4)FEO(3)H2O(1) G0 = -4455225 S0 = 352 V0 = 14.225 c1 = 579.7 c2 = .39494E-1 c3 = -6459300 c5 = -3088.1 b1 = .37E-4 b5 = -.37E-3 b6 = 480000 b7 = -72 b8 = 4 m0 = 226000 m1 = 3.53 m2 = -104.8 end tats EoS = 2 | H= -5987760. MGO(2)AL2O3(1)SIO2(3)H2O(1) G0 = -5605713 S0 = 259 V0 = 13.51 c1 = 549.5 c2 = .36324E-1 c3 = -8606600 c5 = -2515.3 b1 = .37E-4 b5 = -.37E-3 b6 = 480000 b7 = -72 b8 = 4 m0 = 226000 m1 = 3.53 m2 = -104.8 end kao EoS = 2 | H= -4122140. AL2O3(1)SIO2(2)H2O(2) G0 = -3801504 S0 = 203.7 V0 = 9.934 c1 = 436.7 c2 = -.34295E-1 c3 = -4055900 c5 = -2699.1 b1 = .51E-4 b5 = -.51E-3 b6 = 645000 b7 = -96.75 b8 = 4 m0 = 226000 m1 = 3.53 m2 = -104.8 end pre EoS = 2 | H= -6203140. AL2O3(1)SIO2(3)CAO(2)H2O(1) G0 = -5825834 S0 = 292.8 V0 = 14.026 c1 = 724.9 c2 = -.13865E-1 c3 = -2059000 c5 = -6323.9 b1 = .51E-4 b5 = -.51E-3 b6 = 835000 b7 = -125.25 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end chr EoS = 2 | H= -4359130. MGO(3)SIO2(2)H2O(2) G0 = -4031415 S0 = 221.3 V0 = 10.746 c1 = 624.7 c2 = -.2077E-1 c3 = -1721800 c5 = -5619.4 b1 = .47E-4 b5 = -.47E-3 b6 = 525000 b7 = -78.75 b8 = 4 m0 = 146364 m1 = 5.37 m2 = -88.8 end atg EoS = 2 | H= -.7142492E8 MGO(48)SIO2(34)H2O(31) G0 = -66132440 S0 = 3591 V0 = 175.48 c1 = 9621 c2 = -.91183E-1 c3 = -35941600 c5 = -83034.2 b1 = .47E-4 b5 = -.47E-3 b6 = 525000 b7 = -78.75 b8 = 4 m0 = 146364 m1 = 5.37 m2 = -88.8 end ab EoS = 2 | H= -3934530. NA2O(.5)AL2O3(.5)SIO2(3) G0 = -3711877 S0 = 210.1 V0 = 10.006 c1 = 452 c2 = -.13364E-1 c3 = -1275900 c5 = -3953.6 b1 = .456E-4 b5 = -.456E-3 b6 = 593000 b7 = -88.95 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 transition = 1 type = 4 t1 = 950 t2 = 16 t3 = .124 end abh EoS = 2 | H= -3924770. NA2O(.5)AL2O3(.5)SIO2(3) G0 = -3706083 S0 = 223.4 V0 = 10.109 c1 = 452 c2 = -.13364E-1 c3 = -1275900 c5 = -3953.6 b1 = .456E-4 b5 = -.456E-3 b6 = 593000 b7 = -88.95 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 end mic EoS = 2 | H= -3975100. AL2O3(.5)SIO2(3)K2O(.5) G0 = -3750217 S0 = 216 V0 = 10.892 c1 = 448.8 c2 = -.10075E-1 c3 = -1007300 c5 = -3973.1 b1 = .335E-4 b5 = -.335E-3 b6 = 574000 b7 = -86.1 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 end san EoS = 2 | H= -3964950. AL2O3(.5)SIO2(3)K2O(.5) G0 = -3744241 S0 = 230 V0 = 10.9 c1 = 448.8 c2 = -.10075E-1 c3 = -1007300 c5 = -3973.1 b1 = .335E-4 b5 = -.335E-3 b6 = 574000 b7 = -86.1 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 end an EoS = 2 | H= -4233420. AL2O3(1)SIO2(2)CAO(1) G0 = -4007795 S0 = 200 V0 = 10.079 c1 = 371.6 c2 = .12615E-1 c3 = -4110200 c5 = -2038.4 b1 = .238E-4 b5 = -.238E-3 b6 = 919000 b7 = -137.85 b8 = 4 m0 = 421000 m1 = 3.48 m2 = -43 transition = 1 type = 4 t1 = 2300 t2 = 11 t3 = .5E-1 end q EoS = 2 | H= -910840. SIO2(1) G0 = -856424.6 S0 = 41.5 V0 = 2.2688 c1 = 110.7 c2 = -.5189E-2 c5 = -1128.3 b1 = .65E-5 b5 = -.65E-4 b6 = 750000 b7 = -112.5 b8 = 4 m0 = 431250 m1 = .46 m2 = -14 transition = 1 type = 4 t1 = 847 t2 = 4.95 t3 = .1188 end trd EoS = 2 | H= -906690. SIO2(1) G0 = -853646.1 S0 = 46.1 V0 = 2.7 c1 = 97.9 c2 = -.335E-2 c3 = -636200 c5 = -774 b1 = .5E-5 b5 = -.5E-4 b6 = 750000 b7 = -112.5 b8 = 4 m0 = 431250 m1 = .46 m2 = -14 end crst EoS = 2 | H= -906000. SIO2(1) G0 = -853075.4 S0 = 46.5 V0 = 2.61 c1 = 97.9 c2 = -.335E-2 c3 = -636200 c5 = -774 b1 = .81E-5 b5 = -.81E-4 b6 = 600000 b7 = -90 b8 = 4 m0 = 431250 m1 = .46 m2 = -14 end coe EoS = 2 | H= -905490. SIO2(1) G0 = -850865.9 S0 = 40.8 V0 = 2.064 c1 = 96.5 c2 = -.577E-3 c3 = -444800 c5 = -798.2 b1 = .18E-4 b5 = -.18E-3 b6 = 999999.5 b7 = -150 b8 = 4 m0 = 620000 m1 = 1.5 m2 = -150 end | 0.59d6 1.40097 -24. 0. 0. 0. 0. 0. 0. 0. helffrich www1.gly.bris.ac.uk/~ge stv EoS = 2 | H= -875670. SIO2(1) G0 = -816186.1 S0 = 24.5 V0 = 1.4014 c1 = 68.1 c2 = .601E-2 c3 = -1978200 c5 = -82.1 b1 = .25E-4 b5 = -.25E-3 b6 = 3160000. b7 = -474 b8 = 4 m0 = 2170000 m1 = 1.8 m2 = -180 end | 2.26E+06 1.8 -24.0 0. 0. 0. 0. 0. 0. 0. CK '02 ne EoS = 2 | H= -2095070. NA2O(.5)AL2O3(.5)SIO2(1) G0 = -1980443 S0 = 124.4 V0 = 5.419 c1 = 272.7 c2 = -.12398E-1 c5 = -2763.1 b1 = .81E-4 b5 = -.81E-3 b6 = 600000 b7 = -90 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 transition = 1 type = 4 t1 = 467 t2 = 10 t3 = .8E-1 end kals EoS = 2 | H= -2121900. AL2O3(.5)SIO2(1)K2O(.5) G0 = -2006146 S0 = 134 V0 = 6.04 c1 = 242 c2 = -.4482E-2 c3 = -895800 c5 = -1935.8 b1 = .576E-4 b5 = -.576E-3 b6 = 589999.9 b7 = -88.5 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 end lc EoS = 2 | H= -3029170. AL2O3(.5)SIO2(2)K2O(.5) G0 = -2866305 S0 = 200 V0 = 8.828 c1 = 369.8 c2 = -.16332E-1 c3 = 684700 c5 = -3683.1 b1 = .367E-4 b5 = -.367E-3 b6 = 630000 b7 = -94.5 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 transition = 1 type = 4 t1 = 938 t2 = 18 t3 = .482 end me EoS = 2 | H= -.1384337E8 AL2O3(3)SIO2(6)CAO(4)CO2(1) G0 = -13105920 S0 = 752 V0 = 33.985 c1 = 1359 c2 = .36442E-1 c3 = -8594700 c5 = -9598.2 b1 = .316E-4 b5 = -.316E-3 b6 = 870000 b7 = -130.5 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 end wrk EoS = 2 | H= -6666380. AL2O3(1)SIO2(4)CAO(1)H2O(2) G0 = -6220237 S0 = 375 V0 = 19.04 c1 = 838.3 c2 = -.2146E-1 c3 = -2272000 c5 = -7292.3 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end lmt EoS = 2 | H= -7268410. AL2O3(1)SIO2(4)CAO(1)H2O(4) G0 = -6707599 S0 = 457 V0 = 20.37 c1 = 1013.4 c2 = -.21413E-1 c3 = -2235800 c5 = -8806.7 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end heu EoS = 2 | H= -.105991E8 AL2O3(1)SIO2(7)CAO(1)H2O(6) G0 = -9762014 S0 = 669 V0 = 31.8 c1 = 1504.8 c2 = -.33224E-1 c3 = -2959300 c5 = -13297.2 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end stlb EoS = 2 | H= -.1089895E8 AL2O3(1)SIO2(7)CAO(1)H2O(7) G0 = -10004530 S0 = 710 V0 = 32.87 c1 = 1588.4 c2 = -.32043E-1 c3 = -3071600 c5 = -13966.9 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end anl EoS = 2 | H= -3309960. NA2O(.5)AL2O3(.5)SIO2(2)H2O(1) G0 = -3091067 S0 = 232 V0 = 9.74 c1 = 643.5 c2 = -.16067E-1 c3 = 9302300 c5 = -9179.6 b1 = .5E-4 b5 = -.5E-3 b6 = 400000 b7 = -60 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end lime EoS = 2 | H= -634940. CAO(1) G0 = -603297.3 S0 = 38.1 V0 = 1.6764 c1 = 52.4 c2 = .3673E-2 c3 = -750700 c5 = -51 b1 = .665E-4 b5 = -.6649999E-3 b6 = 1160000. b7 = -174 b8 = 4 m0 = 612000 m1 = .9714 m2 = -106 end ru EoS = 2 | H= -944190. TIO2(1) G0 = -888963.7 S0 = 50.6 V0 = 1.882 c1 = 90.4 c2 = .29E-2 c5 = -623.8 b1 = .443E-4 b5 = -.443E-3 b6 = 2224999. b7 = -333.75 b8 = 4 m0 = 1121400 m1 = .78 m2 = -21 end per EoS = 2 | H= -601590. MGO(1) G0 = -569276.5 S0 = 26.9 V0 = 1.125 c1 = 60.5 c2 = .362E-3 c3 = -535800 c5 = -299.2 b1 = .62E-4 b5 = -.62E-3 b6 = 1650000. b7 = -247.5 b8 = 4 m0 = 1121400 m1 = .78 m2 = -21 end mang EoS = 2 | H= -385150. MNO(1) G0 = -362815.6 S0 = 59.7 V0 = 1.3221 c1 = 59.8 c2 = .36E-2 c3 = -31400 c5 = -282.6 b1 = .63E-4 b5 = -.63E-3 b6 = 1640000. b7 = -246 b8 = 4 m0 = 1121400 m1 = .78 m2 = -21 end cor EoS = 2 | H= -1675210. AL2O3(1) G0 = -1581710 S0 = 50.9 V0 = 2.558 c1 = 139.5 c2 = .589E-2 c3 = -2460600 c5 = -589.2 b1 = .419E-4 b5 = -.419E-3 b6 = 2520000. b7 = -378 b8 = 4 m0 = 1620000 m1 = 1.8 m2 = -190 end hem EoS = 2 | H= -825720. FEO(2)O2(.5) G0 = -743740.7 S0 = 87.39999 V0 = 3.0274 c1 = 163.9 c3 = -2257200 c5 = -657.6 b1 = .599E-4 b5 = -.599E-3 b6 = 1996000. b7 = -299.4 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 transition = 1 type = 4 t1 = 955 t2 = 15.6 end NiO EoS = 2 | H= -239440. NIO(1) G0 = -211272.7 S0 = 38 V0 = 1.097 c1 = 47.7 c2 = .7824E-2 c3 = -392500 b1 = .62E-4 b5 = -.62E-3 b6 = 1650000. b7 = -247.5 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 transition = 1 type = 4 t1 = 520 t2 = 5.7 end pnt EoS = 2 | H= -1359180. TIO2(1)MNO(1) G0 = -1280009 S0 = 104.9 V0 = 3.288 c1 = 141.9 c2 = .3373E-2 c3 = -1940700 c5 = -407.6 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 end geik EoS = 2 | H= -1567150. MGO(1)TIO2(1) G0 = -1478745 S0 = 74.60001 V0 = 3.086 c1 = 151 c3 = -1890400 c5 = -652.2 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 m0 = 1320000 m1 = 1.7 m2 = -170 end ilm EoS = 2 | H= -1231270. TIO2(1)FEO(1) G0 = -1154702 S0 = 108.9 V0 = 3.169 c1 = 138.9 c2 = .5081E-2 c3 = -1288800 c5 = -463.7 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 m0 = 910000 m1 = 1.7 m2 = -170 transition = 1 type = 4 t1 = 1900 t2 = 11 t3 = .2E-1 end sp EoS = 2 | H= -2300740. MGO(1)AL2O3(1) G0 = -2176030 S0 = 81.5 V0 = 3.978 c1 = 242.7 c2 = -.6037E-2 c3 = -2315100 c5 = -1678.1 b1 = .431E-4 b5 = -.431E-3 b6 = 1945000. b7 = -291.75 b8 = 4 m0 = 1080000 m1 = .5 m2 = -90 end | 0.64d6 0.2 0. 0. 0. 0. 0. 0. 0. 0. => chang & barsch '73, G'? no dG/dT herc EoS = 2 | H= -1959200. AL2O3(1)FEO(1) G0 = -1843852 S0 = 107.5 V0 = 4.075 c1 = 283.3 c2 = -.5376E-2 c3 = 609800 c5 = -2713.6 b1 = .395E-4 b5 = -.395E-3 b6 = 2120000. b7 = -318 b8 = 4 m0 = 840000 m1 = .4 m2 = -70 end | 0.64d6 0.2 0. 0. 0. 0. 0. 0. 0. 0. => sp value, chang & barsch '73, no dG/dT mt EoS = 2 | H= -1115490. FEO(3)O2(.5) G0 = -1012288 S0 = 146.1 V0 = 4.452 c1 = 262.5 c2 = -.7204E-2 c3 = -1926200 c5 = -1655.7 b1 = .696E-4 b5 = -.696E-3 b6 = 1850000. b7 = -277.5 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 transition = 1 type = 4 t1 = 848 t2 = 35 end mft EoS = 2 | H= -1440650. MGO(1)FEO(2)O2(.5) G0 = -1329995 S0 = 126.5 V0 = 4.457 c1 = 217.9 c2 = .355E-3 c3 = -3108000 c5 = -745.9 b1 = .696E-4 b5 = -.696E-3 b6 = 1850000. b7 = -277.5 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 transition = 1 type = 4 t1 = 665 t2 = 12.9 end usp EoS = 2 | H= -1497470. TIO2(1)FEO(2) G0 = -1401886 S0 = 175 V0 = 4.682 c1 = -102.6 c2 = .14252 c3 = -9144500 c5 = 5270.7 b1 = .69E-4 b5 = -.69E-3 b6 = 1850000. b7 = -277.5 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 end br EoS = 2 | H= -924820. MGO(1)H2O(1) G0 = -834158.6 S0 = 64.5 V0 = 2.463 c1 = 158.4 c2 = -.4076E-2 c3 = -1052300 c5 = -1171.3 b1 = .13E-3 b5 = -.13E-2 b6 = 485000 b7 = -72.75 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 end dsp EoS = 2 | H= -999450. AL2O3(.5)H2O(.5) G0 = -920768.2 S0 = 35 V0 = 1.776 c1 = 145.1 c2 = .8709E-2 c3 = 584400 c5 = -1741.1 b1 = .797E-4 b5 = -.797E-3 b6 = 2300000. b7 = -345 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 end gth EoS = 2 | H= -561660. FEO(1)O2(.25)H2O(.5) G0 = -490870.2 S0 = 60.4 V0 = 2.082 c1 = 139.3 c2 = .147E-3 c3 = -212700 c5 = -1077.8 b1 = .797E-4 b5 = -.797E-3 b6 = 2300000. b7 = -345 b8 = 4 m0 = 915000 m1 = 1.2 m2 = -130 end cc EoS = 2 | H= -1207470. CAO(1)CO2(1) G0 = -1129155 S0 = 92.5 V0 = 3.689 c1 = 140.9 c2 = .5029E-2 c3 = -950700 c5 = -858.4 b1 = .44E-4 b5 = -.44E-3 b6 = 760000 b7 = -114 b8 = 4 m0 = 327000 m1 = .8829 m2 = -143.88 transition = 1 type = 4 t1 = 1240 t2 = 10 t3 = .4E-1 end arag EoS = 2 | H= -1207580. CAO(1)CO2(1) G0 = -1128370 S0 = 89.5 V0 = 3.415 c1 = 192.3 c2 = -.3052E-2 c3 = 1149700 c5 = -2118.3 b1 = .115E-3 b5 = -.115E-2 b6 = 650000 b7 = -97.5 b8 = 4 m0 = 385000 m1 = .8829 m2 = -143.88 transition = 1 type = 4 t1 = 1240 t2 = 9 t3 = .4E-1 end mag EoS = 2 | H= -1111320. MGO(1)CO2(1) G0 = -1027504 S0 = 65.1 V0 = 2.803 c1 = 186.4 c2 = -.3772E-2 c5 = -1886.2 b1 = .648E-4 b5 = -.648E-3 b6 = 1460000. b7 = -219 b8 = 4 m0 = 680000 m1 = .8829 m2 = -143.88 end sid EoS = 2 | H= -761450. FEO(1)CO2(1) G0 = -688158.8 S0 = 95 V0 = 2.938 c1 = 168.4 c5 = -1483.6 b1 = .11E-3 b5 = -.11E-2 b6 = 1200000. b7 = -180 b8 = 4 m0 = 680000 m1 = .8829 m2 = -143.88 end rhc EoS = 2 | H= -891090. MNO(1)CO2(1) G0 = -817283 S0 = 98 V0 = 3.107 c1 = 169.5 c5 = -1534.3 b1 = .65E-4 b5 = -.65E-3 b6 = 800000 b7 = -120 b8 = 4 m0 = 680000 m1 = .8829 m2 = -143.88 end dol EoS = 2 | H= -2324460. MGO(1)CAO(1)CO2(2) G0 = -2161852 S0 = 156 V0 = 6.434 c1 = 358.9 c2 = -.4905E-2 c5 = -3456.2 b1 = .635E-4 b5 = -.6350001E-3 b6 = 900000 b7 = -135 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 transition = 1 type = 4 t1 = 1373 t2 = 13 t3 = .15E-1 end ank EoS = 2 | H= -1971300. CAO(1)FEO(1)CO2(2) G0 = -1819545 S0 = 187 V0 = 6.606 c1 = 341 c2 = -.1161E-2 c5 = -3054.8 b1 = .635E-4 b5 = -.6350001E-3 b6 = 900000 b7 = -135 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 transition = 1 type = 4 t1 = 1273 t2 = 9 t3 = .1E-1 end syv EoS = 2 | H= -436500. K2O(.5)CL2(.5)O2(-.25) G0 = -408605.5 S0 = 82.6 V0 = 3.752 c1 = 46.2 c2 = .1797E-1 b1 = .247E-3 b5 = -.247E-2 b6 = 170000 b7 = -25.5 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 end hlt EoS = 2 | H= -411300. NA2O(.5)CL2(.5)O2(-.25) G0 = -384264.2 S0 = 72.1 V0 = 2.702 c1 = 45.2 c2 = .1797E-1 b1 = .269E-3 b5 = -.269E-2 b6 = 240000 b7 = -36 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 end iron EoS = 2 | H= 0. FEO(1)O2(-.5) G0 = -11.9257 S0 = 27.32 V0 = .7092 c1 = 46.2 c2 = .5158E-2 c3 = 723100 c5 = -556.2 b1 = .746E-4 b5 = -.746E-3 b6 = 1680000. b7 = -252 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 transition = 1 type = 4 t1 = 1042 t2 = 8.3 end Ni EoS = 2 | H= 0. NIO(1)O2(-.5) G0 = 1.121429 S0 = 29.87 V0 = .6588 c1 = 49.8 c3 = 585900 c5 = -533.9 b1 = .886E-4 b5 = -.886E-3 b6 = 1870000. b7 = -280.5 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 transition = 1 type = 4 t1 = 631 t2 = 3 end gph EoS = 2 | H= 0. O2(-1)CO2(1) G0 = -32.79654 S0 = 5.85 V0 = .5298 c1 = 51 c2 = -.4428E-2 c3 = 488600 c5 = -805.5 b1 = .484E-4 b5 = -.484E-3 b6 = 390000 b7 = -58.5 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 end diam EoS = 2 | H= 2100. O2(-1)CO2(1) G0 = 3125.636 S0 = 2.3 V0 = .3417 c1 = 24.3 c2 = .6272E-2 c3 = -377400 c5 = -273.4 b1 = .165E-4 b5 = -.165E-3 b6 = 5800000. b7 = -870 b8 = 4 m0 = 457000 m1 = .8829 m2 = -143.88 end H2O EoS = 1 | H= -241810. H2O(1) G0 = -228542.3 S0 = 188.8 c1 = 40.1 c2 = .8656001E-2 c3 = 487500 c5 = -251.2 m0 = .1E-15 end CO2 EoS = 1 | H= -393510. CO2(1) G0 = -394332.9 S0 = 213.7 c1 = 87.8 c2 = -.2644E-2 c3 = 706400 c5 = -998.9 m0 = .1E-15 end CO EoS = 1 | H= -110530. O2(-.5)CO2(1) G0 = -137163.7 S0 = 197.67 c1 = 45.7 c2 = -.97E-4 c3 = 662700 c5 = -414.7 m0 = .1E-15 end CH4 EoS = 1 | H= -74810. O2(-2)H2O(2)CO2(1) G0 = -50695.63 S0 = 186.26 c1 = 150.1 c2 = .2062E-2 c3 = 3427700 c5 = -2650.4 m0 = .1E-15 end O2 EoS = 1 | H= 0. O2(1) S0 = 205.2 c1 = 48.3 c2 = -.691E-3 c3 = 499200 c5 = -420.7 m0 = .1E-15 end H2 EoS = 1 | H= 0. O2(-.5)H2O(1) G0 = -.4549408E-2 S0 = 130.7 c1 = 23.3 c2 = .4627E-2 c5 = 76.3 m0 = .1E-15 end syvL EoS = 2 | H= -416520. K2O(.5)CL2(.5)O2(-.25) G0 = -392412 S0 = 95.3 V0 = 3.857 c1 = 66.9 b1 = .5E-3 b5 = -.5E-2 b6 = 59000 b7 = -8.85 b8 = 4 m0 = .1E-15 end hltL EoS = 2 | H= -393450. NA2O(.5)CL2(.5)O2(-.25) G0 = -368680.2 S0 = 79.7 V0 = 2.965 c1 = 72 c2 = -.3223E-2 b1 = .5E-3 b5 = -.5E-2 b6 = 66000.01 b7 = -9.9 b8 = 4 m0 = .1E-15 end foL EoS = 2 | H= -2225200. MGO(2)SIO2(1) G0 = -2061346 S0 = -55 V0 = 4.243 c1 = 267.9 b1 = .145E-3 b5 = -.145E-2 b6 = 730000 b7 = -109.5 b8 = 4 m0 = .1E-15 end faL EoS = 2 | H= -1458790. SIO2(1)FEO(2) G0 = -1345114 S0 = 102.5 V0 = 4.695 c1 = 239.7 b1 = .169E-3 b5 = -.169E-2 b6 = 410000 b7 = -61.5 b8 = 4 m0 = .1E-15 end silL EoS = 2 | H= -2583280. AL2O3(1)SIO2(1) G0 = -2419443 S0 = 39 V0 = 6.419 c1 = 237.6 b1 = .1E-4 b5 = -.1E-3 b6 = 300000.1 b7 = -45 b8 = 4 m0 = .1E-15 end anL EoS = 2 | H= -4257680. AL2O3(1)SIO2(2)CAO(1) G0 = -3987929 S0 = 52 V0 = 10.206 c1 = 417.5 b1 = .49E-4 b5 = -.49E-3 b6 = 200000 b7 = -30 b8 = 4 m0 = .1E-15 end h2oL EoS = 2 | H= -296060. H2O(1) G0 = -240067.4 S0 = 45.5 V0 = 1.414 c1 = 80 b1 = .1079E-2 b5 = -.1079E-1 b6 = 40000 b7 = -6 b8 = 4 m0 = .1E-15 end enL EoS = 2 | H= -3091500. MGO(2)SIO2(2) G0 = -2876659 S0 = -2 V0 = 6.9 c1 = 354.9 b1 = .129E-3 b5 = -.129E-2 b6 = 260000 b7 = -39 b8 = 4 m0 = .1E-15 end kspL EoS = 2 | H= -3992580. AL2O3(.5)SIO2(3)K2O(.5) G0 = -3741907 S0 = 129.5 V0 = 11.468 c1 = 367.3 b1 = .6E-4 b5 = -.6E-3 b6 = 260000 b7 = -39 b8 = 4 m0 = .1E-15 end | this entry has been commented out (blank before name): | qL 1 1 0 0 H= -920860. | 0. 0. 0. 1. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -858990.9 16.5 2.64 82.5 0. 0. | 0. 0. 0. 0. -.5E-5 0. | 0. 0. 0.5E-4 491019.6 -70.5 4. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) diL EoS = 2 | H= -3207640. MGO(1)SIO2(2)CAO(1) G0 = -2997823 S0 = 23.8 V0 = 7.34 c1 = 345.3 b1 = .129E-3 b5 = -.129E-2 b6 = 300000.1 b7 = -45 b8 = 4 m0 = .1E-15 end abL EoS = 2 | H= -3934330. NA2O(.5)AL2O3(.5)SIO2(3) G0 = -3692268 S0 = 145 V0 = 10.71 c1 = 358.5 b1 = .45E-4 b5 = -.45E-3 b6 = 390000 b7 = -58.5 b8 = 4 m0 = .1E-15 end tio2 EoS = 1 | H= -944750. TIO2(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end kal3o EoS = 1 AL2O3(1.5)K2O(.5) G0 = 100 V0 = .1E-3 m0 = .1E-15 end kalo2 EoS = 1 AL2O3(.5)K2O(.5) G0 = 100 V0 = .1E-3 m0 = .1E-15 end k2o EoS = 1 K2O(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end sio2 EoS = 1 SIO2(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end na2o EoS = 1 NA2O(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end al2o3 EoS = 1 AL2O3(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end mgo EoS = 1 MGO(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end feo EoS = 1 FEO(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end fe2o3 EoS = 1 FEO(2)O2(.5) G0 = 100 V0 = .1E-3 m0 = .1E-15 end cao EoS = 1 CAO(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end mno EoS = 1 MNO(1) G0 = 100 V0 = .1E-3 m0 = .1E-15 end tichum EoS = 2 | titanian clinhumite fit to bergell and spain data (ideal activity) JADC 7/04 MGO(8.5)SIO2(4)TIO2(.5)H2O(.5) G0 = -9083448. S0 = 426.3732 V0 = 19.4945 c1 = 1036 c2 = -.13045E-1 c3 = -7373450 c5 = -7100.15 b1 = .5583505E-4 b5 = -.5583505E-3 b6 = 2224999. b7 = -333.75 b8 = 4 m0 = .1E-15 end fcrm EoS = 1 | fe-chromite H from klemme FEO(1)CR2O3(1) G0 = -1332863 S0 = 152.2 V0 = 4.441 c1 = 139.75 c2 = .29408E-1 c3 = -3359576 c5 = 474.8 b2 = .1241204E-3 b4 = -.8927955E-6 m0 = .1E-15 end mcrm EoS = 1 | mg-chromite H from klemme MGO(1)CR2O3(1) G0 = -1650534 S0 = 119.6 V0 = 4.356 c1 = 221.24 c2 = -.10203E-2 c3 = -1757210 c5 = -1247.9 b2 = .1241204E-3 b4 = -.8927955E-6 m0 = .1E-15 end esk EoS = 1 | eskolaite CR2O3(1) G0 = -1046177 S0 = 83.1 V0 = 2.9054 c1 = 227.25 c2 = -.2132E-1 c3 = 3543029 c5 = -2567.3 b2 = .697344E-4 b4 = -.523008E-6 m0 = .1E-15 end crts EoS = 2 | opx MGO(1)SIO2(1)CR2O3(1) G0 = -2352378. S0 = 305 V0 = 5.79 c1 = 220 c2 = .47E-2 c3 = -3780000 c5 = -1016 c7 = 344000000 b1 = .508E-4 b5 = -.508E-3 b6 = 1143999. b7 = -171.6 b8 = 4 m0 = .1E-15 end ccrts EoS = 2 | cpx SIO2(1)CAO(1)CR2O3(1) G0 = -2479446. S0 = 305 V0 = 6.65 c1 = 196.2 c2 = .1808E-2 c3 = -5163200 c5 = -226.4 c7 = 344000000 b1 = .4459297E-4 b5 = -.4459297E-3 b6 = 1143999. b7 = -171.6 b8 = 4 m0 = .1E-15 end knor EoS = 2 | adjusted from pyrope to fit clapeyron slope of klemme lithos '04 - 10kJ (origin MGO(3)SIO2(3)CR2O3(1) G0 = -5275960 S0 = 357.8685 V0 = 11.318 c1 = 633.5 c3 = -5196100 c5 = -4375.2 b1 = .436E-4 b5 = -.436E-3 b6 = 1737000. b7 = -260.55 b8 = 4 m0 = .1E-15 end qGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.555755e6 | modified 5/16/2012 from -3383116. to match 1 bar liquidus at 1999 K SIO2(4) G0 = -3363173.2 S0 = 107.93 V0 = 10.76 c1 = 330.4 b2 = -.756E-4 b3 = .52E-7 b8 = -5 m0 = .1E-15 end coGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.307937e6 | modified 5/16/2012 from -3034014. to match 1 bar liquidus at 2320 K AL2O3(2) G0 = -3135674.4 S0 = -44.57 V0 = 7.422 c1 = 340.6 b1 = .524E-3 b2 = -.452E-4 b3 = .54E-7 b8 = -5 m0 = .1E-15 end faGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -1.465621e6 | modified 5/16/2012 from -1336321. to match fa 1 bar liquidus at 1490 K SIO2(1)FEO(2) G0 = -1339255. S0 = 106.41 V0 = 5.42 c1 = 240.2 b1 = .584E-3 b2 = -.279E-4 b3 = -.23E-7 b8 = -5 m0 = .1E-15 end foGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -2.166508e6 | modified 5/16/2012 from -2059270. to match fo 1 bar liquidus at 2163 K MGO(2)SIO2(1) G0 = -2039445. S0 = -47.34 V0 = 4.98 c1 = 271 b1 = .524E-3 b2 = -.135E-4 b3 = -.13E-7 b8 = -5 m0 = .1E-15 end woGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.276717e6 | modified 5/16/2012 from -3108527. to match 1 bar liquidus at 1817 K SIO2(2)CAO(2) G0 = -3117049.6 S0 = 20.31 V0 = 8.694 c1 = 344.8 b1 = .584E-3 b2 = -.31E-4 b3 = -.32E-7 b8 = -5 m0 = .1E-15 end nasGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -8.00742e5 NA2O(.5)SIO2(.5) G0 = -739767.9 S0 = 50.01 V0 = 2.784 c1 = 90.1 b1 = .371E-3 b2 = -.215E-4 b3 = -.265E-7 b8 = -5 m0 = .1E-15 end kalGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -2.127829e6 | modified 5/16/2012 from -2014274. to match fo 1 bar liquidus at 2023 K AL2O3(.5)SIO2(1)K2O(.5) G0 = -2019205.3 S0 = 49.59 V0 = 6.8375 c1 = 217 b1 = .7265E-3 b2 = -.64E-4 b3 = -.46E-7 b8 = -5 m0 = .1E-15 end h2oGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) 6.64e2 H2O(1) G0 = 67460.3 S0 = 9.22 V0 = 2.775 b1 = .1086E-2 b2 = -.6E-4 b8 = -3.5 m0 = .1E-15 end tiGL EoS = 3 | PMELT liquid endmember, G/S adjusted to match 1840 K 1 bar fusion for H&P rutile TIO2(1) G0 = -867802 S0 = 13.0582 V0 = 2.316 c1 = 109.2 b1 = .7246E-3 b2 = -.231E-4 b8 = -5 m0 = .1E-15 end crGL EoS = 3 | PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.555755e6 | g/s to match 1 bar liquidus at 2673 K for mcrm MGO(1)CR2O3(1) G0 = -1745030. S0 = -165.3676 V0 = 5.358 c1 = 335.1 b1 = .1171E-1 b2 = -.113E-4 b3 = .18E-7 b8 = -5 m0 = .1E-15 end