| for domcumentation of Perple_X thermodynamic data file structure and content refer to: | www.perplex.ethz.ch/perplex_thermodynamic_data_file.html | comments are indicated by the | character. | check for warnings at t Holland & Powell '04, tcds55 |<= data base title begin_standard_variables |<= name (<9 characters), reference value, tolerance P(bar) 1.00 0.1E-3 T(K) 298.15 0.1E-4 Y(CO2) 0.00 0.1E-6 mu(C1) 0.00 0.1E-2 mu(C2) 0.00 0.1E-2 end_standard_variables tolerance -.1E-2 |<= DTOL for unconstrained minimization, energy units HSC_conversion |<= tag enabling HSC to SUP apparent energy conversion, requires elemental entropies in the component list below begin_components | < 6 chars, molar weight (g), elemental entropy (R) NA2O 61.9790 205.175 MGO 40.3040 135.255 AL2O3 101.9610 364.425 SIO2 60.0840 223.96 K2O 94.1960 231.935 CAO 56.0770 144.205 TIO2 79.8660 235.87 MNO 70.9370 134.795 FEO 71.8440 129.855 NIO 74.6930 132.375 CE2O3 328.24 451.8 P2O5 141.94 595.2 Y2O3 225.81 396.6 H2O 18.015 188.8 O2 31.999 205.2 ZRO2 123.22 244.2 CO2 44.01 213.8 CL2 70.9060 223.08 end_components begin_special_components H2O CO2 end_special_components begin_makes | the make definitions segment of the thermodynamic | data file is preceeded by the "begin_makes" keyword, | and terminated by the "end_makes" keyword. Within | this segment comments must be preceeded by a "|" | character. | the make definitions define new thermodynamic entities | (e.g., fO2 buffers, endmembers etc) as a linear combination of | the "real" entities in the thermodynamic file. the definition | includes a "DQF" correction that is used to increment the | G of the linearly combined G's as a function of pressure and | temperature, i.e., the total G computed for a made entity is | the G of the right-hand-side of the make reaction + Gdqf. | the format assumes data on one line of less than 240 characters, | the expected format is | name = num_1 * name_1 + num_2 * name_2 ....+ num_int * name_int | dnum_1 dnum_2 dnum_3 | where i num_j is a number or fraction (i.e., two numbers separated | by a '/') and name_j are the names of the j existing entities. | and the dqf correction to the entity 'name' is | Gdqf(J/mol) = dnum_1 + T[K]*dnum_2 + P[bar]*dnum_3 | made entities are excluded from calculations in vertex if they | are included in the excluded phase list in the computational option | file (e.g., "in"); however, real entities to the right of the equals | sign in a make definition are not effected by the excluded phase list. | for example, if qL (liquid silica) is excluded, the make defintion | q8L = 4 qL | will function, but qL will not be considered as a possible phase in | the vertex calculation. | kyco silica buffer | kyco = 1 ky - 1 cor | 0 0 0 | sphene + cc + ru + q CO2 buffer | tcrq = 1 cc + 1 ru + 1 q - 1 sph | 0. 0. 0. | Ti phengite endmember for Auzanneau et al. (CMP 159:1-24, 2010) mica model | Gdqf corrected from -482876. to -13469.8 J/mol, D. Dolejs, Mar 6, 2010. | tip = 1 fcel + 1 geik - 1/2 fs | -13469.8 -14.694 .84 | mthm = 6 hem - 4 mt | mthm O2 buffer | 0 0 0 | qfm = 2 mt + 3 q -3 fa | qfm O2 buffer | 0 0 0 |emog = -1 fo - 2 gph + 1 mag + 1/2 en | EMOG O2 buffer |0 0 0 |ffm = -6 fa + 3 fs + 2 mt | ffm O2 buffer |0 0 0 |fff = 2 fa - 2 iron - 1 fs | iron fa fs O2 buffer |0 0 0 tbi = 1 phl - 1 fo + 1 ru + 1 q | Ti-biotite endmember for TiBio(HP) model 45e3 0 0 | tbi1 = 1 phl - 1 br + 1 ru | Ti-biotite endmember for TiBio(WPH) model | 78e3 0 0 | L Tajcamanova, 5/11/2006. | fbi = 1 east - 1/2 cor + 1/2 hem | Fe3+-biotite endmember for TiBio(WPH) model, definition corrected for | | presumed typo in the WPH (JMG, 2007) paper by L Tajcamanova, 5/11/2007. | 13.45e3 0 0 | fbi = 1 east - 1/2 cor + 1 hem, 8/10/2007, L Tajcamanova | Fe endmembers for ultramafic mineral solution | models, based on the talc Fe-Mg exchange. fbr = 1 br - 1/3 ta + 1/3 fta 0 0 0 fchum = 1 chum - 3 ta + 3 fta 0 0 0 fphA = 1 phA - 7/3 ta + 7/3 fta 0 0 0 fper = 1 per - 1/3 ta + 1/3 fta 0 0 0 fatg = 1 atg - 16 ta + 16 fta 0 0 0 atgts = 4 clin + 9/17 atg - 24/17 br | Tshermaks antigorite for Atg(PN) model (Padrón-Navarta et al., 2013, Lithos) -2e3 46.1 0 odo = 1/2 mag + 1/2 cc | ordered dolmite species for H&P dolomite model -13.5d3 0 0 |-------------------------------------------------------------------------------- | Generic 8-oxygen HP liquid endmembers. Because | these occur in many melts models they are created | here with a nominal DQF, the true model specific | DQF must be added in the solution model. JADC 2/2024 sil8L = 8/5 silL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember fo8L = 2 foL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember fa8L = 2 faL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember q8L = 4 qL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember wi8L = 2 wiL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember cep8L = 2 cepL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember alp8L = 2 alpL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember yp8L = 2 ypL DQF(J/mol) = -10 | a small DQF added to stabilize the made endmember |-------------------------------------------------------------------------------- | endmembers for Green et al (2007) omph model, ds5 databases acm_dqf = 1 acm DQF(J/mol) = -4000 | endmembers for the Diener et al. (JMG, 2007) amphibole models mrb = 1 gl - 2 jd +2 acm | magnesioriebekite, stoichiometry corrected 3/30/08 JADC DQF(J/mol) = 8d3 ts_dqf = 1 ts | tschermakite DQF(J/mol) = 10000 parg_dqf = 1 parg | pargasite, Corrected from 10 kJ, 10/14/11, JADC DQF(J/mol) = 15000 gl_dqf = 1 gl | glaucophane, Corrected from 15 kJ, 10/14/11, MJC DQF(J/mol) = 3000 mpa = 1 parg -1 tr +1 anth | ortho-pargasite, stoichiometry corrected 3/30/08 JADC DQF(J/mol) = 27d3 ged_dqf = 1 ged | gedrite DQF(J/mol) = 22000 ogl_dqf = 1 gl | ortho-glaucophane DQF(J/mol) = 15000 fanth_dq = 1 fanth | ferro-anthophyllite DQF(J/mol) = 7000 omrb_dqf = 1 gl -2 jd +2 acm | ortho-magnesio riebekite (mrb dqf + 25000 J/mol), stoichiometry corrected 3/30/08 JADC DQF(J/mol) = 33000 cumm_dqf = 1 cumm DQF(J/mol) = -6400 grun_dqf = 1 grun DQF(J/mol) = -5000 | make definition for coma of the unpublished | thermocalc scapolite model coma = 3 ab + 1 cc 25000. 0. 0. | titano-clinohumite to fit weiss experiments. JADC, 2/08. | tichum = 4 fo + 1/2 br + 1/2 ru | -33581. 32. 0. tbit = 1 phl - 1 br + 1 ru |Ti-Fe3+ Biotite after Tajcmanova et al. (2009) 84e3 -11.5 0 |Model entered by Lucie Tajcmanova, September, 2008. fbit = 1 east - 1/2 cor + 1/2 hem |Ti-Fe3+ Biotite after Tajcmanova et al. (2009) 6e3 0 0 | Make definitions for the Smye et al (JMG, 2011, 28:753-768) | models for Mica, Carpholite and Chloritoid, to use these | make definitions delete the leading "|" comment characters: ocar = 1 fcar + 1/2 hem - 1/2 cor 45d3 0 0 mncar = 1 mcar + 1 mang - 1 per | corrected from 1 mcar + 1 mang - 1/2 cor, G Hoschek, 10/24/11. 30d3 0 0 octd = 1 fctd + 1/4 hem - 1/4 cor 125d2 0 0 fmu = 1 mu + 1/2 hem - 1/2 cor 30d3 0 0 | corrected from -30 kJ/mol, G Hoschek, 10/24/11. ma_dqf = 1 ma 3d3 0 0 | Make definition for the White et al (JMG, 2005) garnet, Gt(WPPH), JADC, 10/24/11. kho = 1 py - 1 gr + 1 andr 40d3 0 0 | Make definitions for the White et al (JMG, 2000) ilmenite, Ilm(WHP), JADC, 10/29/11. | Corrected coeffiecients for TC un-landau, formerly, the TC DQF was used without | modification. NOTE: the ilm and ilm_nol endmembers must be excluded from calculations | with the Ilm(WPH) model and the ilm_nol, oilm and dilm must be excluded from calculations | without the Ilm(WPH) model. JADC, 6/19/11. dilm = 1 ilm_nol | 1993 -2.1 0 => the TC DQF coeffecients, the values below are | oilm + {DH,R*ln(4),0} 15789.27763 -12.19977769 .1836386612d-1 | made definitions for Sapphirine, O/D non-ideal, Taylor-Jones & Powell | JMG 2010, 28:615-633. JADC, 6/26/2013. | ospr = 1 spr4 - 1 jd + 1 acm | 5d3 0 0 | Make definitions for Kelsey & Powell (JMG, 2011) Zr melting relations. JADC, 2/6/12 zr8L = 2 zrc | Zr-melt endmember 69e3 0 0 zrg = 1 gr + 3 zrc - 6 q | Zr garnet endmember 96e3 0.165e3 2.7 zrru = 1 bdy | Zr rutile endmember 52.84e3 -0.01829e3 -0.074 mots = 1 mgts - 1/2 cor + 1/2 hem | ferric opx endmember MgFe3+AlSiO6 for Opx(HP) 22d3 0 0 end_makes THIS IS THE TCDS.TXT VERSION OF THE THERMOCALC ENDMEMBER DATA FILE. it is essentially the same as the version in hp02ver.dat except that the data predicts a slight shift of the aluminosilicate triple point. This file was converted Nov 14, 2007, JADC. This database does not include shear moduli and therefore cannot be used to compute p- and s-wave velocities (see hp02ver.dat). The Thermocalc data base includes data for ionic aqueous species, this data can be used in Perple_X but was not included to conserve space. To create a data base containing this data run the program HPTOVER and add the electron component. JADC Mar 9, 2002. see comments in hp96-02ver.dat for additional information on changes from the earlier hp94ver.dat and hp90ver.dat files. comments can be written in the data file between entries, provided the first character of comment card is left blank. Notation (not alphabetical!) Entity Symbol Formula akermanite ak Ca2MgSi2O7 almandine alm Fe3Al2Si3O12 andalusite and Al2SiO5 andradite andr Ca3Fe2Si3O12 clinohumite chum Mg9Si4O16(OH)2 clinozoisite cz Ca2Al3Si3O12(OH) cordierite crd Mg2Al4Si5O18 epidote(ordered) ep Ca2FeAl2Si3O12(OH) fayalite fa Fe2SiO4 Fe-chloritoid fctd FeAl2SiO5(OH)2 Fe-cordierite fcrd Fe2Al4Si5O18 Fe-epidote fep Ca2Fe2AlSi3O12(OH) Fe-osumilite fosm KFe2Al5Si10O30 Fe-staurolite fst Fe4Al18Si7.5O48H4 forsterite fo Mg2SiO4 gehlenite geh Ca2Al2SiO7 grossular gr Ca3Al2Si3O12 hydrouscordierite hcrd Mg2Al4Si5O18H2O hydroxy-topaz tpz Al2SiO4(OH)2 kyanite ky Al2SiO5 larnite-bredigite larn Ca2SiO4 lawsonite law CaAl2Si2O7(OH)2H2O merwinite merw Ca3MgSi2O8 Mg-chloritoid mctd MgAl2SiO5(OH)2 Mg-staurolite mst Mg4Al18Si7.5O48H4 Mn-chloritoid mnctd MnAl2SiO5(OH)2 Mn-cordierite mncrd Mn2Al4Si5O18 Mn-staurolite mnst Mn4Al18Si7:5O48H4 monticellite mont CaMgSiO4 osumilite(1) osm1 KMg2Al5Si10O30 osumilite(2) osm2 KMg3Al3Si11O30 phase A phA Mg7Si2O8(OH)6 pumpellyite pump Ca4MgAl5Si6O21(OH)7 pyrope py Mg3Al2Si3O12 rankinite rnk Ca3Si2O7 sillimanite sill Al2SiO5 spessartine spss Mn3Al2Si3O12 sphene sph CaTiSiO5 spurrite spu Ca5Si2O8(CO3) tephroite teph Mn2SiO4 tilleyite ty Ca5Si2O7(CO3)2 vesuvianite vsv Ca19Mg2Al11Si18O69(OH)9 zircon zrc ZrSiO4 zoisite zo Ca2Al3Si3O12(OH) acmite acm NaFeSi2O6 Ca-tschermaks pyroxene cats CaAl2SiO6 Diopside di CaMgSi2O6 enstatite en Mg2Si2O6 ferrosilite fs Fe2Si2O6 hedenbergite hed CaFeSi2O6 jadeite jd NaAlSi2O6 mg-tschermak mgts MgAl2SiO6 pseudowollastonite pswo CaSiO3 pyroxmangite pxmn MnSiO3 rhodonite rhod MnSiO3 wollastonite wo CaSiO3 anthophyllite anth Mg7Si8O22(OH)2 cummingtonite cumm Mg7Si8O22(OH)2 Fe-anthophyllite fanth Fe7Si8O22(OH)2 Fe-glaucophane fgl Na2Fe3Al2Si8O22(OH)2 ferroactinolite ftr Ca2Fe5Si8O22(OH)2 gedrite(Na-free) ged Mg5Al4Si6O22(OH)2 glaucophane gl Na2Mg3Al2Si8O22(OH)2 grunerite grun Fe7Si8O22(OH)2 pargasite parg NaCa2Mg4Al3Si6O22(OH)2 riebeckite rieb Na2Fe5Si8O22(OH)2 tremolite tr Ca2Mg5Si8O22(OH)2 tschermakite ts Ca2Mg3Al4Si6O22(OH)2 deerite deer Fe18Si12O40(OH)10 fe-carpholite fcar FeAl2Si2O6(OH)4 fe-sapphirine(793) fspr Fe3.5Al9Si1.5O20 mg-carpholite mcar MgAl2Si2O6(OH)4 sapphirine(442) spr4 Mg4Al8Si2O20 sapphirine(793) spr7 Mg3.5Al9Si1.5O20 annite ann KFe3AlSi3O10(OH)2 celadonite cel KMgAlSi4O10(OH)2 eastonite east KMg2Al3Si2O10(OH)2 Fe-celadonite fcel KFeAlSi4O10(OH)2 margarite ma CaAl4Si2O10(OH)2 Mn-biotite mnbi KMn3AlSi3O10(OH)2 muscovite mu KAl3Si3O10(OH)2 Na-phlogopite naph NaMg3AlSi3O10(OH)2 paragonite pa NaAl3Si3O10(OH)2 phlogopite phl KMg3AlSi3O10(OH)2 Al-free chlorite afchl Mg6Si4O10(OH)8 amesite(14Ang) ames Mg4Al4Si2O10(OH)8 clinochlore(ordered) clin Mg5Al2Si3O10(OH)8 daphnite daph Fe5Al2Si3O10(OH)8 Fe-sudoite fsud Fe2Al4Si3O10(OH)8 Mn-chlorite mnchl Mn5Al2Si3O10(OH)8 Sudoite sud Mg2Al4Si3O10(OH)8 antigorite atg Mg48Si34O85(OH)62 chrysotile chr Mg3Si2O5(OH)2 Fe-talc fta Fe3Si4O10(OH)2 Kaolinite kao Al2Si2O5(OH)4 prehnite pre Ca2Al2Si3O10(OH)2 pyrophyllite prl Al2Si4O10(OH)2 talc ta Mg3Si4O10(OH)2 tschermak-talc tats Mg2Al2Si3O10(OH)2 albite ab NaAlSi3O8 analcite anl NaAlSi2O6H2O anorthite an CaAl2Si2O8 coesite coe SiO2 cristobalite crst SiO2 heulandite heu CaAl2Si7O186H2O highalbite abh NaAlSi3O8 kalsilite kals KAlSiO4 laumontite lmt CaAl2Si4O124H2O leucite lc KAlSi2O6 meionite me Ca4Al6Si6O24(CO3) microcline mic KAlSi3O8 nepheline ne NaAlSiO4 quartz q SiO2 sanidine san KAlSi3O8 stilbite stlb CaAl2Si7O187H2O stishovite stv SiO2 tridymite trd SiO2 wairakite wrk CaAl2Si4O12H2O3 baddeleyite bdy ZrO2 corundum cor Al2O3 geikielite geik MgTiO3 hematite hem Fe2O3 hercynite herc FeAl2O4 ilmenite ilm FeTiO3 lime lime CaO magnesioferrite mft MgFe2O4 magnetite mt Fe3O4 manganosite mang MnO nickel oxide NiO periclase per MgO pyrophanite pnt MnTiO3 rutile ru TiO2 spinel sp MgAl2O4 ulvospinel usp Fe2TiO4 brucite br Mg(OH)2 diaspore dsp AlO(OH) goethite gth FeO(OH) ankerite ank CaFe(CO3)2 aragonite arag CaCO3 calcite cc CaCO3 dolomite dol CaMg(CO3)2 magnesite mag MgCO3 rhodochrosite rhc MnCO3 siderite sid FeCO3 diamond diam C graphite gph C iron iron Fe nickel Ni Ni carbon dioxide CO2 carbon monoxide CO hydrogen H2 methane CH4 oxygen O2 water fluid H2O albite liquid abL NaAlSi3O8 anorthite liquid anL CaAl2Si2O8 diopside liquid diL CaMgSi2O6 enstatite liquid enL Mg2Si2O6 fayalite liquid faL Fe2SiO4 Fe-liquid (in KFMASH) fliq K3Fe0:5Al4Si19:5O47 Forsterite liquid foL Mg2SiO4 H2O liquid h2oL H2O H2O liquid (in KFMASH) hliq H2O K-feldspar liquid kspL KAlSi3O8 Mg liquid (in KFMASH) mliq K3Mg0:5Al4Si19:5O47 Silica liquid qL SiO2 Sillimanite liquid silL Al2SiO5 H+(aq) H+ Cl(aq) Cl- OH(aq) OH- Na+(aq) Na+ K+(aq) K+ Ca2+(aq) Ca++ Mg2+(aq) Mg++ Fe2+(aq) Fe++ Al3+(aq) Al+++ CO3--(aq) CO3 Al(OH)3(aq) AlOH3 Al(OH)4----(aq) AlOH4- KOH(aq) KOH HCl(aq) HCL KCl(aq) KCL NaCl(aq) NaCl CaCl(aq) CaCl2 CaCl+(aq) CaCl+ MgCl2(aq) MgCl2 MgCl+(aq) MgCl FeCl(aq) FeCl2 Aqueous silica aqSi SiO2 the following "end" card marks the end of the header section of the data file end fo EoS = 2 | H= -2172200. MGO(2)SIO2(1) G0 = -2053098 S0 = 95.1 V0 = 4.366 c1 = 233.3 c2 = .1494E-2 c3 = -603800 c5 = -1869.7 b1 = .613E-4 b5 = -.613E-3 b6 = 1250000. b7 = -187.5 b8 = 4 end fa EoS = 2 | H= -1478150. SIO2(1)FEO(2) G0 = -1378935 S0 = 151 V0 = 4.631 c1 = 201.1 c2 = .1733E-1 c3 = -1960600 c5 = -900.9 b1 = .505E-4 b5 = -.505E-3 b6 = 1330000. b7 = -199.5 b8 = 4 end teph EoS = 2 | H= -1732280. SIO2(1)MNO(2) G0 = -1631705 S0 = 155.9 V0 = 4.899 c1 = 219.6 c3 = -1292700 c5 = -1308.3 b1 = .505E-4 b5 = -.505E-3 b6 = 1200000. b7 = -180 b8 = 4 end lrn EoS = 2 | H= -2307200. SIO2(1)CAO(2) G0 = -2192451 S0 = 127.6 V0 = 5.16 c1 = 247.5 c2 = -.3206E-2 c5 = -2051.9 b1 = .505E-4 b5 = -.505E-3 b6 = 1200000. b7 = -180 b8 = 4 transition = 1 type = 4 t1 = 1710 t2 = 10.03 t3 = .5E-1 end mont EoS = 2 | H= -2253050. MGO(1)SIO2(1)CAO(1) G0 = -2135156 S0 = 108.1 V0 = 5.148 c1 = 250.7 c2 = -.10433E-1 c3 = -797200 c5 = -1996.1 b1 = .563E-4 b5 = -.563E-3 b6 = 1120000. b7 = -168 b8 = 4 end chum EoS = 2 | H= -9607320. MGO(9)SIO2(4)H2O(1) G0 = -9040280 S0 = 445 V0 = 19.785 c1 = 1070 c2 = -.16533E-1 c3 = -7899600 c5 = -7373.9 b1 = .61E-4 b5 = -.61E-3 b6 = 1290000. b7 = -193.5 b8 = 4 end py EoS = 2 | H= -6284720. MGO(3)AL2O3(1)SIO2(3) G0 = -5934074 S0 = 266.3 V0 = 11.318 c1 = 633.5 c3 = -5196100 c5 = -4315.2 b1 = .436E-4 b5 = -.436E-3 b6 = 1737000. b7 = -260.55 b8 = 4 end alm EoS = 2 | H= -5263520. AL2O3(1)SIO2(3)FEO(3) G0 = -4939678 S0 = 340 V0 = 11.511 c1 = 677.3 c3 = -3772700 c5 = -5044 b1 = .403E-4 b5 = -.403E-3 b6 = 1690000. b7 = -253.5 b8 = 4 end spss EoS = 2 | H= -5646400. AL2O3(1)SIO2(3)MNO(3) G0 = -5326378 S0 = 367 V0 = 11.792 c1 = 584.6 c2 = -.1593E-2 c3 = -7516700 c5 = -2750.1 b1 = .462E-4 b5 = -.462E-3 b6 = 1790000. b7 = -268.5 b8 = 4 end gr EoS = 2 | H= -6644150. AL2O3(1)SIO2(3)CAO(3) G0 = -6282130 S0 = 255 V0 = 12.535 c1 = 626 c3 = -5779200 c5 = -4002.9 b1 = .393E-4 b5 = -.393E-3 b6 = 1680000. b7 = -252 b8 = 4 end andr EoS = 2 | H= -5768130. SIO2(3)CAO(3)FEO(2)O2(.5) G0 = -5425532 S0 = 318 V0 = 13.204 c1 = 638.6 c3 = -4955100 c5 = -3989.2 b1 = .393E-4 b5 = -.393E-3 b6 = 1590000. b7 = -238.5 b8 = 4 end osm1 EoS = 2 | H= -.1496819e+8 MGO(2)AL2O3(2.5)SIO2(10)K2O(.5) G0 = -14122370 S0 = 701 V0 = 37.893 c1 = 1625.8 c2 = -.35548E-1 c3 = -8063500 c5 = -13490.9 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 end osm2 EoS = 2 | H= -.1481034e+8 MGO(3)AL2O3(1.5)SIO2(11)K2O(.5) G0 = -13972930 S0 = 724 V0 = 38.44 c1 = 1610.6 c2 = -.34457E-1 c3 = -8262100 c5 = -13128.8 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 end fosm EoS = 2 | H= -.1424846e+8 AL2O3(2.5)SIO2(10)K2O(.5)FEO(2) G0 = -13424050 S0 = 762 V0 = 38.32 c1 = 1656 c2 = -.34163E-1 c3 = -6497700 c5 = -14114.3 b1 = .8E-5 b5 = -.8E-4 b6 = 800000 b7 = -120 b8 = 4 end vsv EoS = 2 | H= -.4235267e+8 MGO(2)AL2O3(5.5)SIO2(18)CAO(19)H2O(4.5) G0 = -39905540 S0 = 1890 V0 = 85.2 c1 = 4488 c2 = -.57952E-1 c3 = -22269300 c5 = -33478 b1 = .5E-4 b5 = -.5E-3 b6 = 1670000. b7 = -250.5 b8 = 4 end and EoS = 2 | H= -2588800. AL2O3(1)SIO2(1) G0 = -2440974 S0 = 92.7 V0 = 5.153 c1 = 277.3 c2 = -.6588E-2 c3 = -1914100 c5 = -2265.6 b1 = .411E-4 b5 = -.411E-3 b6 = 1334000. b7 = -200.1 b8 = 4 end ky EoS = 2 | H= -2593110. AL2O3(1)SIO2(1) G0 = -2442541 S0 = 83.5 V0 = 4.414 c1 = 279.4 c2 = -.7124E-2 c3 = -2055600 c5 = -2289.4 b1 = .404E-4 b5 = -.404E-3 b6 = 1590000. b7 = -238.5 b8 = 4 end sill EoS = 2 | H= -2585680. AL2O3(1)SIO2(1) G0 = -2438689 S0 = 95.5 V0 = 4.986 c1 = 280.2 c2 = -.69E-2 c3 = -1375700 c5 = -2399.4 b1 = .221E-4 b5 = -.221E-3 b6 = 1320000. b7 = -198 b8 = 4 transition = 1 type = 4 t1 = 2200 t2 = 4 t3 = .35E-1 end tpz EoS = 2 | H= -2904980. AL2O3(1)SIO2(1)H2O(1) G0 = -2689922 S0 = 100.5 V0 = 5.339 c1 = 387.7 c2 = -.712E-2 c3 = -857200 c5 = -3744.2 b1 = .404E-4 b5 = -.404E-3 b6 = 1315000. b7 = -197.25 b8 = 4 end mst EoS = 2 | H= -.2510149e+8 MGO(4)AL2O3(9)SIO2(7.5)H2O(2) G0 = -23593360 S0 = 910 V0 = 44.26 c1 = 2820.5 c2 = -.59366E-1 c3 = -13774000 c5 = -24126 b1 = .12E-4 b5 = -.12E-3 b6 = 1200000. b7 = -180 b8 = 4 end fst EoS = 2 | H= -.2375393e+8 AL2O3(9)SIO2(7.5)FEO(4)H2O(2) G0 = -22282050 S0 = 1010 V0 = 44.88 c1 = 2880 c2 = -.56595E-1 c3 = -10642000 c5 = -25373 b1 = .12E-4 b5 = -.12E-3 b6 = 1200000. b7 = -180 b8 = 4 end mnst EoS = 2 | H= -.2420388e+8 AL2O3(9)SIO2(7.5)MNO(4)H2O(2) G0 = -22730540 S0 = 1024 V0 = 45.46 c1 = 2873.3 c2 = -.89064E-1 c3 = -12688000 c5 = -24749 b1 = .12E-4 b5 = -.12E-3 b6 = 1200000. b7 = -180 b8 = 4 end mctd EoS = 2 | H= -3551420. MGO(1)AL2O3(1)SIO2(1)H2O(1) G0 = -3307805 S0 = 140 V0 = 6.875 c1 = 464.4 c2 = -.12654E-1 c3 = -1147200 c5 = -4341 b1 = .542E-4 b5 = -.542E-3 b6 = 1465000. b7 = -219.75 b8 = 4 end fctd EoS = 2 | H= -3215380. AL2O3(1)SIO2(1)FEO(1)H2O(1) G0 = -2977847 S0 = 155 V0 = 6.98 c1 = 484.6 c2 = -.13808E-1 c3 = -198900 c5 = -4762.2 b1 = .542E-4 b5 = -.542E-3 b6 = 1465000. b7 = -219.75 b8 = 4 end mnctd EoS = 2 | H= -3329280. AL2O3(1)SIO2(1)MNO(1)H2O(1) G0 = -3093616 S0 = 166 V0 = 7.175 c1 = 464.4 c2 = -.12654E-1 c3 = -1147200 c5 = -4341 b1 = .542E-4 b5 = -.542E-3 b6 = 1465000. b7 = -219.75 b8 = 4 end merw EoS = 2 | H= -4546420. MGO(1)SIO2(2)CAO(3) G0 = -4318964 S0 = 253.1 V0 = 9.847 c1 = 417.5 c2 = .8117E-2 c3 = -2923000 c5 = -2320.3 b1 = .615E-4 b5 = -.615E-3 b6 = 1200000. b7 = -180 b8 = 4 end spu EoS = 2 | H= -5849520. SIO2(2)CAO(5)CO2(1) G0 = -5536430 S0 = 330 V0 = 14.697 c1 = 614.1 c2 = -.3508E-2 c3 = -2493100 c5 = -4168 b1 = .65E-4 b5 = -.65E-3 b6 = 950000 b7 = -142.5 b8 = 4 end zo EoS = 2 | H= -6898610. AL2O3(1.5)SIO2(3)CAO(2)H2O(.5) G0 = -6502998 S0 = 297 V0 = 13.575 c1 = 595.7 c2 = .62297E-1 c3 = -5921300 c5 = -3394.7 b1 = .67E-4 b5 = -.67E-3 b6 = 1120000. b7 = -168 b8 = 4 end cz EoS = 2 | H= -6898150. AL2O3(1.5)SIO2(3)CAO(2)H2O(.5) G0 = -6503730 S0 = 301 V0 = 13.63 c1 = 567 c2 = .18063E-1 c3 = -7034000 c5 = -2603 b1 = .46E-4 b5 = -.46E-3 b6 = 1120000. b7 = -168 b8 = 4 end fep EoS = 2 | H= -6002180. AL2O3(.5)SIO2(3)CAO(2)FEO(2)O2(.5)H2O(.5) G0 = -5625095 S0 = 357 V0 = 14.19 c1 = 520.1 c2 = .31499E-1 c3 = -15426000 c5 = 218.8 b1 = .505E-4 b5 = -.505E-3 b6 = 1294000. b7 = -194.1 b8 = 4 end ep EoS = 2 | H= -6463210. AL2O3(1)SIO2(3)CAO(2)FEO(1)O2(.25)H2O(.5) G0 = -6077160 S0 = 328 V0 = 13.91 c1 = 544.6 c2 = .24781E-1 c3 = -11230000 c5 = -1192.1 b1 = .505E-4 b5 = -.505E-3 b6 = 1233000. b7 = -184.95 b8 = 4 end law EoS = 2 | H= -4869140. AL2O3(1)SIO2(2)CAO(1)H2O(2) G0 = -4513342 S0 = 230 V0 = 10.132 c1 = 687.8 c2 = .1566E-2 c3 = 375900 c5 = -7179.2 b1 = .582E-4 b5 = -.582E-3 b6 = 1014000. b7 = -152.1 b8 = 4 end pump EoS = 2 | H= -.143895e+8 MGO(1)AL2O3(2.5)SIO2(6)CAO(4)H2O(3.5) G0 = -13448820 S0 = 629 V0 = 29.55 c1 = 1720.8 c2 = -.24928E-1 c3 = -5998700 c5 = -14620.3 b1 = .5E-4 b5 = -.5E-3 b6 = 1615000. b7 = -242.25 b8 = 4 end geh EoS = 2 | H= -3986880. AL2O3(1)SIO2(1)CAO(2) G0 = -3785638 S0 = 202 V0 = 9.024 c1 = 405.7 c2 = -.7099E-2 c3 = -1188300 c5 = -3174.4 b1 = .417E-4 b5 = -.417E-3 b6 = 1080000. b7 = -162 b8 = 4 transition = 1 type = 4 t1 = 700 t2 = 11 t3 = .97E-1 end ak EoS = 2 | H= -3866360. MGO(1)SIO2(2)CAO(2) G0 = -3669802 S0 = 212.5 V0 = 9.254 c1 = 385.4 c2 = .3209E-2 c3 = -247500 c5 = -2889.9 b1 = .508E-4 b5 = -.508E-3 b6 = 1420000. b7 = -213 b8 = 4 end rnk EoS = 2 | H= -3944430. SIO2(2)CAO(3) G0 = -3744458 S0 = 210 V0 = 9.651 c1 = 372.3 c2 = -.2893E-2 c3 = -2462400 c5 = -2181.3 b1 = .65E-4 b5 = -.65E-3 b6 = 950000 b7 = -142.5 b8 = 4 end ty EoS = 2 | H= -6368160. SIO2(2)CAO(5)CO2(2) G0 = -6010067 S0 = 390 V0 = 17.039 c1 = 741.7 c2 = -.5345E-2 c3 = -1434600 c5 = -5878.5 b1 = .65E-4 b5 = -.65E-3 b6 = 950000 b7 = -142.5 b8 = 4 end crd EoS = 2 | H= -9163370. MGO(2)AL2O3(2)SIO2(5) G0 = -8652904 S0 = 407.5 V0 = 23.322 c1 = 821.3 c2 = .43339E-1 c3 = -8211200 c5 = -5000 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end hcrd EoS = 2 | H= -9446980. MGO(2)AL2O3(2)SIO2(5)H2O(1) G0 = -8890748 S0 = 487.3 V0 = 23.322 c1 = 869.7 c2 = .51995E-1 c3 = -7723700 c5 = -5251.2 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end fcrd EoS = 2 | H= -8436070. AL2O3(2)SIO2(5)FEO(2) G0 = -7948950 S0 = 475 V0 = 23.71 c1 = 851.5 c2 = .44724E-1 c3 = -6645000 c5 = -5623.4 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end mncrd EoS = 2 | H= -8681180. AL2O3(2)SIO2(5)MNO(2) G0 = -8191239 S0 = 475 V0 = 24.027 c1 = 847.7 c2 = .2849E-1 c3 = -7668200 c5 = -5311.4 b1 = .76E-5 b5 = -.76E-4 b6 = 810000 b7 = -121.5 b8 = 4 transition = 1 type = 4 t1 = 1800 t2 = 20 t3 = .2 end phA EoS = 2 | H= -7130410. MGO(7)SIO2(2)H2O(3) G0 = -6610174 S0 = 350 V0 = 15.442 c1 = 964 c2 = -.11521E-1 c3 = -4517800 c5 = -7724.7 b1 = .826E-4 b5 = -.826E-3 b6 = 1450000. b7 = -217.5 b8 = 4 end sph EoS = 2 | H= -2595550. SIO2(1)CAO(1)TIO2(1) G0 = -2454564 S0 = 131.2 V0 = 5.565 c1 = 233.7 c2 = .4043E-2 c3 = -2306500 c5 = -1207.6 b1 = .42E-4 b5 = -.42E-3 b6 = 1100000. b7 = -165 b8 = 4 end zrc EoS = 2 | H= -2032770. SIO2(1)ZRO2(1) G0 = -1918228 S0 = 84.03 V0 = 3.926 c1 = 237 c2 = -.1788E-1 c3 = -149600 c5 = -2267.8 b1 = .222E-4 b5 = -.222E-3 b6 = 1160000. b7 = -174 b8 = 4 end en EoS = 2 | H= -3090470. MGO(2)SIO2(2) G0 = -2915730 S0 = 132.5 V0 = 6.262 c1 = 356.2 c2 = -.299E-2 c3 = -596900 c5 = -3185.3 b1 = .505E-4 b5 = -.505E-3 b6 = 1070000. b7 = -160.5 b8 = 4 end fs EoS = 2 | H= -2388630. SIO2(2)FEO(2) G0 = -2234433 S0 = 190.6 V0 = 6.592 c1 = 398.7 c2 = -.6579E-2 c3 = 1290100 c5 = -4058 b1 = .632E-4 b5 = -.632E-3 b6 = 1010000. b7 = -151.5 b8 = 4 end mgts EoS = 2 | H= -3189320. MGO(1)AL2O3(1)SIO2(1) G0 = -3012580 S0 = 131 V0 = 5.9 c1 = 371.4 c2 = -.4082E-2 c3 = -398400 c5 = -3547.1 b1 = .508E-4 b5 = -.508E-3 b6 = 1143999. b7 = -171.6 b8 = 4 end di EoS = 2 | H= -3202760. MGO(1)SIO2(2)CAO(1) G0 = -3028393 S0 = 142.7 V0 = 6.619 c1 = 314.5 c2 = .41E-4 c3 = -2745900 c5 = -2020.1 b1 = .57E-4 b5 = -.57E-3 b6 = 1223000. b7 = -183.45 b8 = 4 end hed EoS = 2 | H= -2844160. SIO2(2)CAO(1)FEO(1) G0 = -2680795 S0 = 174.2 V0 = 6.795 c1 = 340.2 c2 = .812E-3 c3 = -1047800 c5 = -2646.7 b1 = .57E-4 b5 = -.57E-3 b6 = 1200000. b7 = -180 b8 = 4 end jd EoS = 2 | H= -3027850. NA2O(.5)AL2O3(.5)SIO2(2) G0 = -2849148 S0 = 133.5 V0 = 6.04 c1 = 301.1 c2 = .10143E-1 c3 = -2239300 c5 = -2055.1 b1 = .466E-4 b5 = -.466E-3 b6 = 1284000. b7 = -192.6 b8 = 4 end acm EoS = 2 | H= -2586650. NA2O(.5)SIO2(2)FEO(1)O2(.25) G0 = -2419328 S0 = 170.6 V0 = 6.459 c1 = 307.1 c2 = .16758E-1 c3 = -1685500 c5 = -2125.8 b1 = .466E-4 b5 = -.466E-3 b6 = 1060000. b7 = -159 b8 = 4 end cats EoS = 2 | H= -3307030. AL2O3(1)SIO2(1)CAO(1) G0 = -3129708 S0 = 138 V0 = 6.356 c1 = 347.6 c2 = -.6974E-2 c3 = -1781600 c5 = -2757.5 b1 = .443E-4 b5 = -.443E-3 b6 = 1140000. b7 = -171 b8 = 4 end rhod EoS = 2 | H= -1321750. SIO2(1)MNO(1) G0 = -1244792 S0 = 100.5 V0 = 3.494 c1 = 138.4 c2 = .4088E-2 c3 = -1936000 c5 = -538.9 b1 = .508E-4 b5 = -.508E-3 b6 = 1250000. b7 = -187.5 b8 = 4 end pxmn EoS = 2 | H= -1322530. SIO2(1)MNO(1) G0 = -1245214 S0 = 99.3 V0 = 3.472 c1 = 138.4 c2 = .4088E-2 c3 = -1936000 c5 = -538.9 b1 = .508E-4 b5 = -.508E-3 b6 = 1250000. b7 = -187.5 b8 = 4 end wo EoS = 2 | H= -1634060. SIO2(1)CAO(1) G0 = -1548867 S0 = 82.5 V0 = 3.993 c1 = 159.3 c3 = -967300 c5 = -1075.4 b1 = .46E-4 b5 = -.46E-3 b6 = 795000 b7 = -119.25 b8 = 4 end pswo EoS = 2 | H= -1627690. SIO2(1)CAO(1) G0 = -1544196 S0 = 88.2 V0 = 4.008 c1 = 157.8 c3 = -967300 c5 = -1075.4 b1 = .539E-4 b5 = -.539E-3 b6 = 1050000. b7 = -157.5 b8 = 4 end tr EoS = 2 | H= -.1231038e+8 MGO(5)SIO2(8)CAO(2)H2O(1) G0 = -11582820 S0 = 550 V0 = 27.27 c1 = 1260.2 c2 = .383E-2 c3 = -11455000 c5 = -8237.601 b1 = .534E-4 b5 = -.534E-3 b6 = 762000.1 b7 = -114.3 b8 = 4 end ftr EoS = 2 | H= -.1051124e+8 SIO2(8)CAO(2)FEO(5)H2O(1) G0 = -9837946 S0 = 705 V0 = 28.28 c1 = 1290 c2 = .29991E-1 c3 = -8447500 c5 = -8947 b1 = .534E-4 b5 = -.534E-3 b6 = 760000 b7 = -114 b8 = 4 end ts EoS = 2 | H= -.125412e+8 MGO(3)AL2O3(2)SIO2(6)CAO(2)H2O(1) G0 = -11809040 S0 = 545 V0 = 26.8 c1 = 1244.8 c2 = .24348E-1 c3 = -11965000 c5 = -8112.1 b1 = .534E-4 b5 = -.534E-3 b6 = 760000 b7 = -114 b8 = 4 end parg EoS = 2 | H= -.1272065e+8 NA2O(.5)MGO(4)AL2O3(1.5)SIO2(6)CAO(2)H2O(1) G0 = -11988600 S0 = 601 V0 = 27.19 c1 = 1280.2 c2 = .22997E-1 c3 = -12359500 c5 = -8065.8 b1 = .534E-4 b5 = -.534E-3 b6 = 912000 b7 = -136.8 b8 = 4 end gl EoS = 2 | H= -.1196947e+8 NA2O(1)MGO(3)AL2O3(1)SIO2(8)H2O(1) G0 = -11234260 S0 = 535 V0 = 26.05 c1 = 1717.5 c2 = -.12107 c3 = 7075000 c5 = -19272 b1 = .53E-4 b5 = -.53E-3 b6 = 882999.9 b7 = -132.45 b8 = 4 end fgl EoS = 2 | H= -.1088974e+8 NA2O(1)AL2O3(1)SIO2(8)FEO(3)H2O(1) G0 = -10185890 S0 = 624 V0 = 26.59 c1 = 1762.9 c2 = -.118992 c3 = 9423700 c5 = -20207.1 b1 = .53E-4 b5 = -.53E-3 b6 = 890000 b7 = -133.5 b8 = 4 end rieb EoS = 2 | H= -.1003524e+8 NA2O(1)SIO2(8)FEO(5)O2(.5)H2O(1) G0 = -9352005 S0 = 691 V0 = 27.49 c1 = 1746.9 c2 = -.113572 c3 = 9370300 c5 = -19468.7 b1 = .53E-4 b5 = -.53E-3 b6 = 890000 b7 = -133.5 b8 = 4 end anth EoS = 2 | H= -.120692e+8 MGO(7)SIO2(8)H2O(1) G0 = -11342800 S0 = 536 V0 = 26.54 c1 = 1277.3 c2 = .25825E-1 c3 = -9704600 c5 = -9074.7 b1 = .5E-4 b5 = -.5E-3 b6 = 700000.1 b7 = -105 b8 = 4 end fanth EoS = 2 | H= -9627230. SIO2(8)FEO(7)H2O(1) G0 = -8968456 S0 = 725 V0 = 27.87 c1 = 1383.1 c2 = .30669E-1 c3 = -4224700 c5 = -11257.6 b1 = .5E-4 b5 = -.5E-3 b6 = 700000.1 b7 = -105 b8 = 4 end cumm EoS = 2 | H= -.1205748e+8 MGO(7)SIO2(8)H2O(1) G0 = -11332280 S0 = 540 V0 = 26.33 c1 = 1277.3 c2 = .25825E-1 c3 = -9704600 c5 = -9074.7 b1 = .5E-4 b5 = -.5E-3 b6 = 700000.1 b7 = -105 b8 = 4 end grun EoS = 2 | H= -9613200. SIO2(8)FEO(7)H2O(1) G0 = -8955916 S0 = 730 V0 = 27.84 c1 = 1383.1 c2 = .30669E-1 c3 = -4224700 c5 = -11257.6 b1 = .5E-4 b5 = -.5E-3 b6 = 648000 b7 = -97.2 b8 = 4 end ged EoS = 2 | H= -.1231943e+8 MGO(5)AL2O3(2)SIO2(6)H2O(1) G0 = -11583670 S0 = 515 V0 = 25.8 c1 = 1307.7 c2 = .23642E-1 c3 = -9307400 c5 = -9799 b1 = .48E-4 b5 = -.48E-3 b6 = 770000 b7 = -115.5 b8 = 4 end spr4 EoS = 2 | H= -.1101962e+8 MGO(4)AL2O3(4)SIO2(2) G0 = -10422090 S0 = 443 V0 = 19.905 c1 = 1160.3 c2 = -.24324E-1 c3 = -7706600 c5 = -8974.2 b1 = .49E-4 b5 = -.49E-3 b6 = 1200000. b7 = -180 b8 = 4 end spr7 EoS = 2 | H= -.1106563e+8 MGO(3.5)AL2O3(4.5)SIO2(1.5) G0 = -10468810 S0 = 448 V0 = 19.775 c1 = 1167.9 c2 = -.2487E-1 c3 = -7607300 c5 = -9155.3 b1 = .49E-4 b5 = -.49E-3 b6 = 1200000. b7 = -180 b8 = 4 end fspr EoS = 2 | H= -9835510. AL2O3(4.5)SIO2(1.5)FEO(3.5) G0 = -9275034 S0 = 551 V0 = 20.391 c1 = 1257.8 c2 = -.22171E-1 c3 = -1664000 c5 = -11348.4 b1 = .49E-4 b5 = -.49E-3 b6 = 1200000. b7 = -180 b8 = 4 end mcar EoS = 2 | H= -4781240. MGO(1)AL2O3(1)SIO2(2)H2O(2) G0 = -4422148 S0 = 210 V0 = 10.59 c1 = 667.8 c2 = -.12559E-1 c3 = -1167100 c5 = -6440 b1 = .5E-4 b5 = -.5E-3 b6 = 525000 b7 = -78.75 b8 = 4 end fcar EoS = 2 | H= -4413200. AL2O3(1)SIO2(2)FEO(1)H2O(2) G0 = -4069135 S0 = 255 V0 = 10.69 c1 = 674.8 c2 = -.10092E-1 c3 = -715800 c5 = -6554.5 b1 = .5E-4 b5 = -.5E-3 b6 = 525000 b7 = -78.75 b8 = 4 end deer EoS = 2 | H= -.1834765e+8 SIO2(12)FEO(18)O2(1.5)H2O(5) G0 = -16901550 S0 = 1650 V0 = 55.74 c1 = 3164.4 c2 = -.27883E-1 c3 = -5039100 c5 = -26721 b1 = .5E-4 b5 = -.5E-3 b6 = 630000 b7 = -94.5 b8 = 4 end mu EoS = 2 | H= -5984180. AL2O3(1.5)SIO2(3)K2O(.5)H2O(1) G0 = -5603722 S0 = 292 V0 = 14.083 c1 = 756.4 c2 = -.1984E-1 c3 = -2170000 c5 = -6979.2 b1 = .596E-4 b5 = -.596E-3 b6 = 490000 b7 = -73.5 b8 = 4 end cel EoS = 2 | H= -5842420. MGO(1)AL2O3(.5)SIO2(4)K2O(.5)H2O(1) G0 = -5462920 S0 = 290 V0 = 13.957 c1 = 741.2 c2 = -.18748E-1 c3 = -2368800 c5 = -6616.9 b1 = .596E-4 b5 = -.596E-3 b6 = 700000.1 b7 = -105 b8 = 4 end fcel EoS = 2 | H= -5477430. AL2O3(.5)SIO2(4)K2O(.5)FEO(1)H2O(1) G0 = -5111168 S0 = 329 V0 = 14.07 c1 = 756.3 c2 = -.19147E-1 c3 = -1586100 c5 = -6928.7 b1 = .596E-4 b5 = -.596E-3 b6 = 700000.1 b7 = -105 b8 = 4 end pa EoS = 2 | H= -5946340. NA2O(.5)AL2O3(1.5)SIO2(3)H2O(1) G0 = -5565102 S0 = 276 V0 = 13.211 c1 = 803 c2 = -.3158E-1 c3 = 217000 c5 = -8151 b1 = .774E-4 b5 = -.774E-3 b6 = 550000 b7 = -82.5 b8 = 4 end ma EoS = 2 | H= -6241230. AL2O3(2)SIO2(2)CAO(1)H2O(1) G0 = -5857347 S0 = 267 V0 = 12.964 c1 = 744.4 c2 = -.168E-1 c3 = -2074400 c5 = -6783.2 b1 = .487E-4 b5 = -.487E-3 b6 = 1300000. b7 = -195 b8 = 4 end phl EoS = 2 | H= -6219160. MGO(3)AL2O3(.5)SIO2(3)K2O(.5)H2O(1) G0 = -5837110 S0 = 328 V0 = 14.964 c1 = 770.3 c2 = -.36939E-1 c3 = -2328900 c5 = -6531.6 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 end ann EoS = 2 | H= -5151670. AL2O3(.5)SIO2(3)K2O(.5)FEO(3)H2O(1) G0 = -4801284 S0 = 418 V0 = 15.432 c1 = 815.7 c2 = -.34861E-1 c3 = 19800 c5 = -7466.7 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 end mnbi EoS = 2 | H= -5462840. AL2O3(.5)SIO2(3)K2O(.5)MNO(3)H2O(1) G0 = -5112696 S0 = 433 V0 = 15.264 c1 = 809.9 c2 = -.59213E-1 c3 = -1514400 c5 = -6998.7 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 end east EoS = 2 | H= -6338170. MGO(2)AL2O3(1.5)SIO2(2)K2O(.5)H2O(1) G0 = -5951586 S0 = 318 V0 = 14.738 c1 = 785.5 c2 = -.38031E-1 c3 = -2130300 c5 = -6893.7 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 end naph EoS = 2 | H= -6172820. NA2O(.5)MGO(3)AL2O3(.5)SIO2(3)H2O(1) G0 = -5791778 S0 = 318 V0 = 14.45 c1 = 773.5 c2 = -.40229E-1 c3 = -2597900 c5 = -6512.6 b1 = .579E-4 b5 = -.579E-3 b6 = 513000 b7 = -76.95 b8 = 4 end clin EoS = 2 | H= -8912410. MGO(5)AL2O3(1)SIO2(3)H2O(4) G0 = -8251820 S0 = 430.5 V0 = 21.09 c1 = 1161.8 c2 = .10133E-1 c3 = -7657300 c5 = -9690.899 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end ames EoS = 2 | H= -9034440. MGO(4)AL2O3(2)SIO2(2)H2O(4) G0 = -8366184 S0 = 410 V0 = 20.52 c1 = 1177 c2 = .9041E-2 c3 = -7458700 c5 = -10053 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end afchl EoS = 2 | H= -8727380. MGO(6)SIO2(4)H2O(4) G0 = -8067598 S0 = 428 V0 = 21.66 c1 = 1146.6 c2 = .11225E-1 c3 = -7855900 c5 = -9328.8 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end daph EoS = 2 | H= -7134850. AL2O3(1)SIO2(3)FEO(5)H2O(4) G0 = -6522411 S0 = 565 V0 = 21.34 c1 = 1237.4 c2 = .13594E-1 c3 = -3743000 c5 = -11250 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end mnchl EoS = 2 | H= -7666530. AL2O3(1)SIO2(3)MNO(5)H2O(4) G0 = -7055984 S0 = 595 V0 = 22.59 c1 = 1227.8 c2 = -.2699E-1 c3 = -6299800 c5 = -10469.4 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end sud EoS = 2 | H= -8626160. MGO(2)AL2O3(2)SIO2(3)H2O(4) G0 = -7969994 S0 = 404 V0 = 20.3 c1 = 1436.1 c2 = -.48749E-1 c3 = -2748500 c5 = -13764 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end fsud EoS = 2 | H= -7903900. AL2O3(2)SIO2(3)FEO(2)H2O(4) G0 = -7268247 S0 = 462 V0 = 20.4 c1 = 1466.3 c2 = -.47365E-1 c3 = -1182800 c5 = -14388 b1 = .398E-4 b5 = -.398E-3 b6 = 870000 b7 = -130.5 b8 = 4 end prl EoS = 2 | H= -5640640. AL2O3(1)SIO2(4)H2O(1) G0 = -5266628 S0 = 239.4 V0 = 12.81 c1 = 784.5 c2 = -.42948E-1 c3 = 1251000 c5 = -8495.9 b1 = .75E-4 b5 = -.75E-3 b6 = 525000 b7 = -78.75 b8 = 4 end ta EoS = 2 | H= -5897100. MGO(3)SIO2(4)H2O(1) G0 = -5516905 S0 = 260 V0 = 13.625 c1 = 622.2 c3 = -6385500 c5 = -3916.3 b1 = .37E-4 b5 = -.37E-3 b6 = 480000 b7 = -72 b8 = 4 end fta EoS = 2 | H= -4802920. SIO2(4)FEO(3)H2O(1) G0 = -4454985 S0 = 352 V0 = 14.225 c1 = 579.7 c2 = .39494E-1 c3 = -6459300 c5 = -3088.1 b1 = .37E-4 b5 = -.37E-3 b6 = 480000 b7 = -72 b8 = 4 end tats EoS = 2 | H= -5987990. MGO(2)AL2O3(1)SIO2(3)H2O(1) G0 = -5605944 S0 = 259 V0 = 13.51 c1 = 549.5 c2 = .36324E-1 c3 = -8606600 c5 = -2515.3 b1 = .37E-4 b5 = -.37E-3 b6 = 480000 b7 = -72 b8 = 4 end kao EoS = 2 | H= -4122180. AL2O3(1)SIO2(2)H2O(2) G0 = -3801544 S0 = 203.7 V0 = 9.934 c1 = 436.7 c2 = -.34295E-1 c3 = -4055900 c5 = -2699.1 b1 = .51E-4 b5 = -.51E-3 b6 = 645000 b7 = -96.75 b8 = 4 end pre EoS = 2 | H= -6203180. AL2O3(1)SIO2(3)CAO(2)H2O(1) G0 = -5825874 S0 = 292.8 V0 = 14.026 c1 = 724.9 c2 = -.13865E-1 c3 = -2059000 c5 = -6323.9 b1 = .51E-4 b5 = -.51E-3 b6 = 835000 b7 = -125.25 b8 = 4 end chr EoS = 2 | H= -4359030. MGO(3)SIO2(2)H2O(2) G0 = -4031316 S0 = 221.3 V0 = 10.746 c1 = 624.7 c2 = -.2077E-1 c3 = -1721800 c5 = -5619.4 b1 = .47E-4 b5 = -.47E-3 b6 = 525000 b7 = -78.75 b8 = 4 end atg EoS = 2 | H= -.7142431e+8 MGO(48)SIO2(34)H2O(31) G0 = -66131830 S0 = 3591 V0 = 175.48 c1 = 9621 c2 = -.91183E-1 c3 = -35941600 c5 = -83034.2 b1 = .47E-4 b5 = -.47E-3 b6 = 525000 b7 = -78.75 b8 = 4 end ab EoS = 2 | H= -3934560. NA2O(.5)AL2O3(.5)SIO2(3) G0 = -3711908 S0 = 210.1 V0 = 10.006 c1 = 452 c2 = -.13364E-1 c3 = -1275900 c5 = -3953.6 b1 = .456E-4 b5 = -.456E-3 b6 = 593000 b7 = -88.95 b8 = 4 transition = 1 type = 4 t1 = 950 t2 = 16 t3 = .124 end abh EoS = 2 | H= -3924800. NA2O(.5)AL2O3(.5)SIO2(3) G0 = -3706113 S0 = 223.4 V0 = 10.109 c1 = 452 c2 = -.13364E-1 c3 = -1275900 c5 = -3953.6 b1 = .456E-4 b5 = -.456E-3 b6 = 593000 b7 = -88.95 b8 = 4 end mic EoS = 2 | H= -3975110. AL2O3(.5)SIO2(3)K2O(.5) G0 = -3750228 S0 = 216 V0 = 10.892 c1 = 448.8 c2 = -.10075E-1 c3 = -1007300 c5 = -3973.1 b1 = .335E-4 b5 = -.335E-3 b6 = 574000 b7 = -86.1 b8 = 4 end san EoS = 2 | H= -3964960. AL2O3(.5)SIO2(3)K2O(.5) G0 = -3744252 S0 = 230 V0 = 10.9 c1 = 448.8 c2 = -.10075E-1 c3 = -1007300 c5 = -3973.1 b1 = .335E-4 b5 = -.335E-3 b6 = 574000 b7 = -86.1 b8 = 4 end an EoS = 2 | H= -4233480. AL2O3(1)SIO2(2)CAO(1) G0 = -4007855 S0 = 200 V0 = 10.079 c1 = 371.6 c2 = .12615E-1 c3 = -4110200 c5 = -2038.4 b1 = .238E-4 b5 = -.238E-3 b6 = 919000 b7 = -137.85 b8 = 4 transition = 1 type = 4 t1 = 2300 t2 = 11 t3 = .5E-1 end q EoS = 2 | H= -910830. SIO2(1) G0 = -856414.6 S0 = 41.5 V0 = 2.2688 c1 = 110.7 c2 = -.5189E-2 c5 = -1128.3 b1 = .65E-5 b5 = -.65E-4 b6 = 750000 b7 = -112.5 b8 = 4 transition = 1 type = 4 t1 = 847 t2 = 4.95 t3 = .1188 end trd EoS = 2 | H= -906690. SIO2(1) G0 = -853646.1 S0 = 46.1 V0 = 2.7 c1 = 97.9 c2 = -.335E-2 c3 = -636200 c5 = -774 b1 = .5E-5 b5 = -.5E-4 b6 = 750000 b7 = -112.5 b8 = 4 end crst EoS = 2 | H= -905990. SIO2(1) G0 = -853065.4 S0 = 46.5 V0 = 2.61 c1 = 97.9 c2 = -.335E-2 c3 = -636200 c5 = -774 b1 = .81E-5 b5 = -.81E-4 b6 = 600000 b7 = -90 b8 = 4 end coe EoS = 2 | H= -905470. SIO2(1) G0 = -850845.9 S0 = 40.8 V0 = 2.064 c1 = 96.5 c2 = -.577E-3 c3 = -444800 c5 = -798.2 b1 = .18E-4 b5 = -.18E-3 b6 = 999999.5 b7 = -150 b8 = 4 end stv EoS = 2 | H= -875630. SIO2(1) G0 = -816146.1 S0 = 24.5 V0 = 1.4014 c1 = 68.1 c2 = .601E-2 c3 = -1978200 c5 = -82.1 b1 = .25E-4 b5 = -.25E-3 b6 = 3160000. b7 = -474 b8 = 4 end ne EoS = 2 | H= -2095080. NA2O(.5)AL2O3(.5)SIO2(1) G0 = -1980453 S0 = 124.4 V0 = 5.419 c1 = 272.7 c2 = -.12398E-1 c5 = -2763.1 b1 = .81E-4 b5 = -.81E-3 b6 = 600000 b7 = -90 b8 = 4 transition = 1 type = 4 t1 = 467 t2 = 10 t3 = .8E-1 end kals EoS = 2 | H= -2121920. AL2O3(.5)SIO2(1)K2O(.5) G0 = -2006166 S0 = 134 V0 = 6.04 c1 = 242 c2 = -.4482E-2 c3 = -895800 c5 = -1935.8 b1 = .576E-4 b5 = -.576E-3 b6 = 589999.9 b7 = -88.5 b8 = 4 end lc EoS = 2 | H= -3029160. AL2O3(.5)SIO2(2)K2O(.5) G0 = -2866296 S0 = 200 V0 = 8.828 c1 = 369.8 c2 = -.16332E-1 c3 = 684700 c5 = -3683.1 b1 = .367E-4 b5 = -.367E-3 b6 = 630000 b7 = -94.5 b8 = 4 transition = 1 type = 4 t1 = 938 t2 = 18 t3 = .482 end me EoS = 2 | H= -.1384357e+8 AL2O3(3)SIO2(6)CAO(4)CO2(1) G0 = -13106120 S0 = 752 V0 = 33.985 c1 = 1359 c2 = .36442E-1 c3 = -8594700 c5 = -9598.2 b1 = .316E-4 b5 = -.316E-3 b6 = 870000 b7 = -130.5 b8 = 4 end wrk EoS = 2 | H= -6666420. AL2O3(1)SIO2(4)CAO(1)H2O(2) G0 = -6220278 S0 = 375 V0 = 19.04 c1 = 838.3 c2 = -.2146E-1 c3 = -2272000 c5 = -7292.3 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 end lmt EoS = 2 | H= -7268470. AL2O3(1)SIO2(4)CAO(1)H2O(4) G0 = -6707659 S0 = 457 V0 = 20.37 c1 = 1013.4 c2 = -.21413E-1 c3 = -2235800 c5 = -8806.7 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 end heu EoS = 2 | H= -.1059914e+8 AL2O3(1)SIO2(7)CAO(1)H2O(6) G0 = -9762054 S0 = 669 V0 = 31.8 c1 = 1504.8 c2 = -.33224E-1 c3 = -2959300 c5 = -13297.2 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 end stlb EoS = 2 | H= -.1089883e+8 AL2O3(1)SIO2(7)CAO(1)H2O(7) G0 = -10004410 S0 = 710 V0 = 32.87 c1 = 1588.4 c2 = -.32043E-1 c3 = -3071600 c5 = -13966.9 b1 = .238E-4 b5 = -.238E-3 b6 = 999999.5 b7 = -150 b8 = 4 end anl EoS = 2 | H= -3309900. NA2O(.5)AL2O3(.5)SIO2(2)H2O(1) G0 = -3091007 S0 = 232 V0 = 9.74 c1 = 643.5 c2 = -.16067E-1 c3 = 9302300 c5 = -9179.6 b1 = .5E-4 b5 = -.5E-3 b6 = 400000 b7 = -60 b8 = 4 end lime EoS = 2 | H= -634950. CAO(1) G0 = -603307.3 S0 = 38.1 V0 = 1.6764 c1 = 52.4 c2 = .3673E-2 c3 = -750700 c5 = -51 b1 = .665E-4 b5 = -.6649999E-3 b6 = 1160000. b7 = -174 b8 = 4 end ru EoS = 2 | H= -944180. TIO2(1) G0 = -888953.7 S0 = 50.6 V0 = 1.882 c1 = 90.4 c2 = .29E-2 c5 = -623.8 b1 = .443E-4 b5 = -.443E-3 b6 = 2225000. b7 = -333.75 b8 = 4 end per EoS = 2 | H= -601600. MGO(1) G0 = -569286.5 S0 = 26.9 V0 = 1.125 c1 = 60.5 c2 = .362E-3 c3 = -535800 c5 = -299.2 b1 = .62E-4 b5 = -.62E-3 b6 = 1650000. b7 = -247.5 b8 = 4 end mang EoS = 2 | H= -385150. MNO(1) G0 = -362815.6 S0 = 59.7 V0 = 1.3221 c1 = 59.8 c2 = .36E-2 c3 = -31400 c5 = -282.6 b1 = .63E-4 b5 = -.63E-3 b6 = 1640000. b7 = -246 b8 = 4 end cor EoS = 2 | H= -1675250. AL2O3(1) G0 = -1581750 S0 = 50.9 V0 = 2.558 c1 = 139.5 c2 = .589E-2 c3 = -2460600 c5 = -589.2 b1 = .419E-4 b5 = -.419E-3 b6 = 2520000. b7 = -378 b8 = 4 end hem EoS = 2 | H= -825710. FEO(2)O2(.5) G0 = -743730.7 S0 = 87.39999 V0 = 3.0274 c1 = 163.9 c3 = -2257200 c5 = -657.6 b1 = .599E-4 b5 = -.599E-3 b6 = 1996000. b7 = -299.4 b8 = 4 transition = 1 type = 4 t1 = 955 t2 = 15.6 end NiO EoS = 2 | H= -239440. NIO(1) G0 = -211272.7 S0 = 38 V0 = 1.097 c1 = 47.7 c2 = .7824E-2 c3 = -392500 b1 = .62E-4 b5 = -.62E-3 b6 = 1650000. b7 = -247.5 b8 = 4 transition = 1 type = 4 t1 = 520 t2 = 5.7 end pnt EoS = 2 | H= -1359240. TIO2(1)MNO(1) G0 = -1280069 S0 = 104.9 V0 = 3.288 c1 = 141.9 c2 = .3373E-2 c3 = -1940700 c5 = -407.6 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 end geik EoS = 2 | H= -1567490. MGO(1)TIO2(1) G0 = -1479086 S0 = 74.60001 V0 = 3.086 c1 = 151 c3 = -1890400 c5 = -652.2 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 end ilm EoS = 2 | H= -1231300. TIO2(1)FEO(1) G0 = -1154732 S0 = 108.9 V0 = 3.169 c1 = 138.9 c2 = .5081E-2 c3 = -1288800 c5 = -463.7 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 transition = 1 type = 4 t1 = 1900 t2 = 11 t3 = .2E-1 end ilm_nol EoS = 2 | created from ilm for Ilm(WPH) by suppressing the Landau model TIO2(1)FEO(1) G0 = -1154732 S0 = 108.9 V0 = 3.169 c1 = 138.9 c2 = .5081E-2 c3 = -1288800 c5 = -463.7 b1 = .495E-4 b5 = -.495E-3 b6 = 1770000. b7 = -265.5 b8 = 4 end bdy EoS = 2 | H= -1101030. ZRO2(1) G0 = -1043250 S0 = 50.4 V0 = 2.115 c1 = 90.7 c3 = -813300 c5 = -438.8 b1 = .376E-4 b5 = -.376E-3 b6 = 2225000. b7 = -333.75 b8 = 4 end sp EoS = 2 | H= -2300720. MGO(1)AL2O3(1) G0 = -2176010 S0 = 81.5 V0 = 3.978 c1 = 242.7 c2 = -.6037E-2 c3 = -2315100 c5 = -1678.1 b1 = .431E-4 b5 = -.431E-3 b6 = 1945000. b7 = -291.75 b8 = 4 end herc EoS = 2 | H= -1959150. AL2O3(1)FEO(1) G0 = -1843802 S0 = 107.5 V0 = 4.075 c1 = 283.3 c2 = -.5376E-2 c3 = 609800 c5 = -2713.6 b1 = .395E-4 b5 = -.395E-3 b6 = 2120000. b7 = -318 b8 = 4 end mt EoS = 2 | H= -1115510. FEO(3)O2(.5) G0 = -1012308 S0 = 146.1 V0 = 4.452 c1 = 262.5 c2 = -.7204E-2 c3 = -1926200 c5 = -1655.7 b1 = .696E-4 b5 = -.696E-3 b6 = 1850000. b7 = -277.5 b8 = 4 transition = 1 type = 4 t1 = 848 t2 = 35 end mft EoS = 2 | H= -1440660. MGO(1)FEO(2)O2(.5) G0 = -1330005 S0 = 126.5 V0 = 4.457 c1 = 217.9 c2 = .355E-3 c3 = -3108000 c5 = -745.9 b1 = .696E-4 b5 = -.696E-3 b6 = 1850000. b7 = -277.5 b8 = 4 transition = 1 type = 4 t1 = 665 t2 = 12.9 end usp EoS = 2 | H= -1497490. TIO2(1)FEO(2) G0 = -1401906 S0 = 175 V0 = 4.682 c1 = -102.6 c2 = .14252 c3 = -9144500 c5 = 5270.7 b1 = .69E-4 b5 = -.69E-3 b6 = 1850000. b7 = -277.5 b8 = 4 end br EoS = 2 | H= -924920. MGO(1)H2O(1) G0 = -834258.6 S0 = 64.5 V0 = 2.463 c1 = 158.4 c2 = -.4076E-2 c3 = -1052300 c5 = -1171.3 b1 = .13E-3 b5 = -.13E-2 b6 = 485000 b7 = -72.75 b8 = 4 end dsp EoS = 2 | H= -999470. AL2O3(.5)H2O(.5) G0 = -920788.2 S0 = 35 V0 = 1.776 c1 = 145.1 c2 = .8709E-2 c3 = 584400 c5 = -1741.1 b1 = .797E-4 b5 = -.797E-3 b6 = 2300000. b7 = -345 b8 = 4 end gth EoS = 2 | H= -561650. FEO(1)O2(.25)H2O(.5) G0 = -490860.2 S0 = 60.4 V0 = 2.082 c1 = 139.3 c2 = .147E-3 c3 = -212700 c5 = -1077.8 b1 = .797E-4 b5 = -.797E-3 b6 = 2300000. b7 = -345 b8 = 4 end cc EoS = 2 | H= -1207470. CAO(1)CO2(1) G0 = -1129155 S0 = 92.5 V0 = 3.689 c1 = 140.9 c2 = .5029E-2 c3 = -950700 c5 = -858.4 b1 = .44E-4 b5 = -.44E-3 b6 = 760000 b7 = -114 b8 = 4 transition = 1 type = 4 t1 = 1240 t2 = 10 t3 = .4E-1 end arag EoS = 2 | H= -1207580. CAO(1)CO2(1) G0 = -1128370 S0 = 89.5 V0 = 3.415 c1 = 192.3 c2 = -.3052E-2 c3 = 1149700 c5 = -2118.3 b1 = .115E-3 b5 = -.115E-2 b6 = 650000 b7 = -97.5 b8 = 4 transition = 1 type = 4 t1 = 1240 t2 = 9 t3 = .4E-1 end mag EoS = 2 | H= -1111360. MGO(1)CO2(1) G0 = -1027544 S0 = 65.1 V0 = 2.803 c1 = 186.4 c2 = -.3772E-2 c5 = -1886.2 b1 = .648E-4 b5 = -.648E-3 b6 = 1460000. b7 = -219 b8 = 4 end sid EoS = 2 | H= -761440. FEO(1)CO2(1) G0 = -688148.8 S0 = 95 V0 = 2.938 c1 = 168.4 c5 = -1483.6 b1 = .11E-3 b5 = -.11E-2 b6 = 1200000. b7 = -180 b8 = 4 end rhc EoS = 2 | H= -891090. MNO(1)CO2(1) G0 = -817283 S0 = 98 V0 = 3.107 c1 = 169.5 c5 = -1534.3 b1 = .65E-4 b5 = -.65E-3 b6 = 800000 b7 = -120 b8 = 4 end dol EoS = 2 | H= -2324430. MGO(1)CAO(1)CO2(2) G0 = -2161822 S0 = 156 V0 = 6.434 c1 = 358.9 c2 = -.4905E-2 c5 = -3456.2 b1 = .635E-4 b5 = -.6350001E-3 b6 = 900000 b7 = -135 b8 = 4 transition = 1 type = 4 t1 = 1373 t2 = 13 t3 = .15E-1 end ank EoS = 2 | H= -1971270. CAO(1)FEO(1)CO2(2) G0 = -1819515 S0 = 187 V0 = 6.606 c1 = 341 c2 = -.1161E-2 c5 = -3054.8 b1 = .635E-4 b5 = -.6350001E-3 b6 = 900000 b7 = -135 b8 = 4 transition = 1 type = 4 t1 = 1273 t2 = 9 t3 = .1E-1 end | syv 1 0 0 0 H= -436500. | 0. 0. 0. 0. 0.5 0. 0. 0. 0. 0. 0. 0.50 -0.25 0. 0. | -408605.5 82.6 3.752 46.2 0.1797e-1 0. | 0. 0. 0. 0. 0.247e-3 0. | 0. 0. -.247e-2 177602.8 -25.5 4. | hlt 1 0 0 0 H= -411300. | 0.5 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0.50 -0.25 0. 0. | -384264.2 72.1 2.702 45.2 0.1797e-1 0. | 0. 0. 0. 0. 0.269e-3 0. | 0. 0. -.269e-2 250733.4 -36. 4. iron EoS = 2 | H= 0. FEO(1)O2(-.5) G0 = -11.9257 S0 = 27.32 V0 = .7092 c1 = 46.2 c2 = .5158E-2 c3 = 723100 c5 = -556.2 b1 = .746E-4 b5 = -.746E-3 b6 = 1680000. b7 = -252 b8 = 4 transition = 1 type = 4 t1 = 1042 t2 = 8.3 end | Ni 1 010 0 H= 0. | 0. 0. 0. 0. 0. 0. 0. 0. 0. 1. 0. 0. -0.5 0. 0. | 1.121429 29.87 0.6588 49.8 0. 585900. | 0. -533.9 0. 0. 0.886e-4 0. | 0. 0. -.886e-3 1953631. -280.5 4. | 631. 3. 0. 0. 0. 0. | 0. 0. 0. 0. gph EoS = 2 | H= 0. O2(-1)CO2(1) G0 = -32.79654 S0 = 5.85 V0 = .5298 c1 = 51 c2 = -.4428E-2 c3 = 488600 c5 = -805.5 b1 = .484E-4 b5 = -.484E-3 b6 = 390000 b7 = -58.5 b8 = 4 end diam EoS = 2 | H= 2070. O2(-1)CO2(1) G0 = 3095.636 S0 = 2.3 V0 = .3417 c1 = 24.3 c2 = .6272E-2 c3 = -377400 c5 = -273.4 b1 = .165E-4 b5 = -.165E-3 b6 = 5800000. b7 = -870 b8 = 4 end H2O EoS = 101 | H= -241810. H2O(1) G0 = -228542.3 S0 = 188.8 c1 = 40.1 c2 = .8656001E-2 c3 = 487500 c5 = -251.2 end CO2 EoS = 102 | H= -393510. CO2(1) G0 = -394332.9 S0 = 213.7 c1 = 87.8 c2 = -.2644E-2 c3 = 706400 c5 = -998.9 end | CO 1 0 0 0 H= -110530. | 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. -0.5 0. 1.00 | -137163.7 197.67 0. 45.7 -.97e-4 662700. | 0. -414.7 0. 0. 0. 0. | 0. 0. 0. 0. 0. 0. | CH4 1 0 0 0 H= -74810. | 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. -2. 2. 1.00 | -50695.63 186.26 0. 150.1 0.2062e-2 3427700. | 0. -2650.4 0. 0. 0. 0. | 0. 0. 0. 0. 0. 0. O2 EoS = 107 | H= 0. O2(1) S0 = 205.2 c1 = 48.3 c2 = -.691E-3 c3 = 499200 c5 = -420.7 end H2 EoS = 105 | H= 0. O2(-.5)H2O(1) G0 = -.4549408E-2 S0 = 130.7 c1 = 23.3 c2 = .4627E-2 c5 = 76.3 end syvL EoS = 2 | H= -416490. K2O(.5)CL2(.5)O2(-.25) G0 = -392382 S0 = 95.3 V0 = 3.857 c1 = 66.9 b1 = .5E-3 b5 = -.5E-2 b6 = 59000 b7 = -8.85 b8 = 4 end hltL EoS = 2 | H= -393420. NA2O(.5)CL2(.5)O2(-.25) G0 = -368650.2 S0 = 79.7 V0 = 2.965 c1 = 72 c2 = -.3223E-2 b1 = .5E-3 b5 = -.5E-2 b6 = 66000.01 b7 = -9.9 b8 = 4 end foL EoS = 2 | H= -2225160. MGO(2)SIO2(1) G0 = -2061306 S0 = -55 V0 = 4.243 c1 = 267.9 b1 = .145E-3 b5 = -.145E-2 b6 = 730000 b7 = -109.5 b8 = 4 end faL EoS = 2 | H= -1459210. SIO2(1)FEO(2) G0 = -1345534 S0 = 102.5 V0 = 4.695 c1 = 239.7 b1 = .169E-3 b5 = -.169E-2 b6 = 410000 b7 = -61.5 b8 = 4 end silL EoS = 2 | H= -2583100. AL2O3(1)SIO2(1) G0 = -2419264 S0 = 39 V0 = 6.419 c1 = 237.6 b1 = .1E-4 b5 = -.1E-3 b6 = 300000.1 b7 = -45 b8 = 4 end anL EoS = 2 | H= -4257750. AL2O3(1)SIO2(2)CAO(1) G0 = -3987999 S0 = 52 V0 = 10.206 c1 = 417.5 b1 = .49E-4 b5 = -.49E-3 b6 = 200000 b7 = -30 b8 = 4 end h2oL EoS = 2 | H= -295710. H2O(1) G0 = -239717.4 S0 = 45.5 V0 = 1.414 c1 = 80 b1 = .1079E-2 b5 = -.1079E-1 b6 = 40000 b7 = -6 b8 = 4 end enL EoS = 2 | H= -3091760. MGO(2)SIO2(2) G0 = -2876919 S0 = -2 V0 = 6.9 c1 = 354.9 b1 = .129E-3 b5 = -.129E-2 b6 = 260000 b7 = -39 b8 = 4 end kspL EoS = 2 | H= -3992670. AL2O3(.5)SIO2(3)K2O(.5) G0 = -3741998 S0 = 129.5 V0 = 11.468 c1 = 367.3 b1 = .6E-4 b5 = -.6E-3 b6 = 260000 b7 = -39 b8 = 4 end qL EoS = 2 | H= -920850. SIO2(1) G0 = -858980.9 S0 = 16.5 V0 = 2.64 c1 = 82.5 b1 = -.5E-5 b5 = .5E-4 b6 = 470000 b7 = -70.5 b8 = 4 end diL EoS = 2 | H= -3208180. MGO(1)SIO2(2)CAO(1) G0 = -2998363 S0 = 23.8 V0 = 7.34 c1 = 345.3 b1 = .129E-3 b5 = -.129E-2 b6 = 300000.1 b7 = -45 b8 = 4 end abL EoS = 2 | H= -3934370. NA2O(.5)AL2O3(.5)SIO2(3) G0 = -3692308 S0 = 145 V0 = 10.71 c1 = 358.5 b1 = .45E-4 b5 = -.45E-3 b6 = 390000 b7 = -58.5 b8 = 4 end kal3o EoS = 1 AL2O3(1.5)K2O(.5) G0 = 100 V0 = .1E-3 end kalo2 EoS = 1 AL2O3(.5)K2O(.5) G0 = 100 V0 = .1E-3 end k2o EoS = 1 K2O(1) G0 = 100 V0 = .1E-3 end na2o EoS = 1 NA2O(1) G0 = 100 V0 = .1E-3 end Si(s) EoS = 2 | Silicon metal, not from HP data base, JADC 1/2010 SIO2(1)O2(-1) S0 = 18.82 V0 = 1.21 c1 = 36.12 c2 = -.398E-3 c3 = .8987E-2 c5 = -285.3 b1 = .9E-5 b5 = -.9E-4 b6 = 933470.1 b7 = -146 b8 = 4 m0 = .1E-15 end SiC EoS = 2 | Silicon Carbide, not from HP data base, JADC 1/2010 SIO2(1)O2(-2)CO2(1) G0 = -69139 S0 = 16.485 V0 = 2.1652 c1 = 64.21 c2 = .3308E-2 c3 = .1991E-1 c5 = -631.7 b1 = .831E-5 b5 = -.831E-4 b6 = 2139822. b7 = -336 b8 = 4 m0 = .1E-15 end fpum EoS = 2 | ferro-pumpellyite from Massonne & Willner, EJM, 2008 AL2O3(2.5)SIO2(6)CAO(4)FEO(1)H2O(3.5) G0 = -13099500 S0 = 654 V0 = 29.72 c1 = 1568.5 c3 = -26900000 c5 = -10207.2 c7 = .3560562E10 b1 = .5E-4 b5 = -.5E-3 b6 = 1615000. b7 = -242.25 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end ffpu EoS = 2 | ferro-pumpellyite from Massonne & Willner, EJM, 2008 AL2O3(2)SIO2(6)CAO(4)FEO(2)O2(.25)H2O(3.5) G0 = -12672500 S0 = 687 V0 = 30.1 c1 = 1574.92 c3 = -24553960 c5 = -10268.96 c7 = .3154003E10 b1 = .5E-4 b5 = -.5E-3 b6 = 1615000. b7 = -242.25 b8 = 4 m0 = 454000 m1 = .97133 m2 = -68 end acti EoS = 2 | actinolite from Massonne & Willner, EJM, 2008 MGO(3)SIO2(8)CAO(2)FEO(2)H2O(1) G0 = -10903000 S0 = 614 V0 = 27.67 c1 = 1258.028 c3 = -24442220 c5 = -7489.36 c7 = .3162433E10 b1 = .534E-4 b5 = -.534E-3 b6 = 761253.7 b7 = -114 b8 = 4 m0 = 617000 m1 = 1.19757 m2 = -96 end mrie EoS = 2 | magnesio-riebeckite from Massonne & Willner, EJM, 2008 NA2O(1)MGO(3)SIO2(8)FEO(2)O2(.5)H2O(1) G0 = -10370000 S0 = 602 V0 = 27.13 c1 = 1246.525 c3 = -29546270 c5 = -6823.08 c7 = .3998917E10 b1 = .534E-4 b5 = -.534E-3 b6 = 761253.7 b7 = -114 b8 = 4 m0 = 617000 m1 = 1.19757 m2 = -96 end stlp EoS = 2 | stilpnomelane from Massonne & Willner, EJM, 2008 AL2O3(2.5)SIO2(67)K2O(2.5)FEO(48)H2O(60) G0 = -91150000 S0 = 7364 V0 = 303.7 c1 = 15936.51 c3 = -181141800 c5 = -124844 c7 = .2860103E11 b1 = .596E-4 b5 = -.596E-3 b6 = 490000 b7 = -73.5 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end mstl EoS = 2 | magnesio-stilpnomelane from Massonne & Willner, EJM, 2008 MGO(48)AL2O3(2.5)SIO2(67)K2O(2.5)H2O(60) G0 = -107600000 S0 = 5911 V0 = 296.5 c1 = 15032.19 c3 = -248561600 c5 = -104513 c7 = .3374243E11 b1 = .596E-4 b5 = -.596E-3 b6 = 490000 b7 = -73.5 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end mnsp EoS = 2 | manganese-stilpnomelane from Massonne & Willner, EJM, 2008 AL2O3(2.5)SIO2(67)K2O(2.5)MNO(48)H2O(60) G0 = -97200000 S0 = 7642 V0 = 313.3 c1 = 12238.78 c3 = -181141800 c5 = -96778 c7 = .2833413E11 b1 = .596E-4 b5 = -.596E-3 b6 = 490000 b7 = -73.5 b8 = 4 m0 = 353000 m1 = 1.21 m2 = -54 end kcym EoS = 2 | potassium whatever from Massonne & Willner, EJM, 2008 AL2O3(.5)SIO2(3)K2O(.5)H2O(1) G0 = -3966800 S0 = 278.6 V0 = 11.459 c1 = 481.225 c3 = -9931330 c5 = -2980.73 c7 = 1416000000 b1 = .335E-4 b5 = -.335E-3 b6 = 574000 b7 = -86.1 b8 = 4 m0 = 301000 m1 = 4.26 m2 = -70 end |Fe-BCC EoS = 600 | Komabayashi & Fei JGR 2010 Special EoS |FEO(1)O2(-.5) |0 = -6.5 V0 = .709 |c1 = 1400 c2 = 124.06 c3 = -25.5143 c4 = -.439752E-2 c5 = -.58927E-7 c6 = 77359 |b1 = .262E-4 b2 = .18E-7 b6 = 1640000 b8 = -5.29 |m0 = 454000 m1 = .97133 m2 = -68 |end |Fe-FCC EoS = 601 | Komabayashi & Fei JGR 2010 Special EoS |FEO(1)O2(-.5) |S0 = -6.5 V0 = .6835 |c1 = 16300.92 c2 = 381.4716 c3 = -52.2754 c4 = .177578E-3 c6 = -395355.4 |b1 = .64E-4 b6 = 1653000 b8 = -5.5 |m0 = 454000 m1 = .97133 m2 = -68 |end |Fe-HCP EoS = 602 | Komabayashi & Fei JGR 2010 Special EoS (dummy alpha & delta) |FEO(1)O2(-.5) |S0 = -4.97 V0 = .6765 |c1 = 14405.92 c2 = 384.8716 c3 = -52.2754 c4 = .177578E-3 c6 = -395355.4 |b1 = .64E-4 b6 = 16500000 b8 = -4.97 |m0 = 454000 m1 = .97133 m2 = -68 |end |Fe-Liq EoS = 603 | Komabayashi & Fei JGR 2010 Special EoS |FEO(1)O2(-.5) |S0 = -5.22 V0 = .6921 |c1 = -9007.34 c2 = 290.2987 c3 = -46 |b1 = .92E-4 b6 = 12400000 b8 = -5.77 |m0 = 454000 m1 = .97133 m2 = -68 |end skiag EoS = 2 | Malaspina et al., 2009. Skiagite garnet SIO2(3)FEO(5)O2(.5) G0 = -4072.02e3 S0 = 369.871 V0 = 12.135 c1 = 870.4 c2 = -.14476 c3 = -400450 c4 = .43207E-4 c5 = -8652.6 b1 = .2336E-4 b2 = .70286E-8 b4 = -.295 b6 = 1574000 b8 = 6.7 end | the data below has been commented out (by insertion of a blank character in the | column) because the data is from the hp02ver.dat file and should, at least in t | be corrected for the hp04 changes. | qGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.555755e6 | 0. 0. 0. 4. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -3383116.3 107.93 10.760 330.4 0. 0. 0. 0. 0. 0. | 0e0 -7.56E-5 5.2E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | coGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.307937e6 | 0. 0. 2. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -3034014.3 -44.57 7.4220 340.6 0. 0. 0. 0. 0. 0. | 5.24E-4 -4.52E-5 5.4E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | faGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -1.465621e6 | 0. 0. 0. 1. 0. 0. 0. 0. 2. 0. 0. 0. 0. 0. 0. | -1336321.3 106.41 5.420 240.2 0. 0. 0. 0. 0. 0. | 5.84E-4 -2.79E-5 -2.3E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | foGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -2.166508e6 | 0. 2. 0. 1. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -2059270.2 -47.34 4.980 271.0 0. 0. 0. 0. 0. 0. | 5.24E-4 -1.35E-5 -1.3E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | woGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -3.276717e6 | 0. 0. 0. 2. 0. 2. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -3108527.4 20.31 8.6940 344.8 0. 0. 0. 0. 0. 0. | 5.84E-4 -3.1E-5 -3.2E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | nasGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -8.00742e5 | 0.5 0. 0. 0.5 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -739767.9 50.01 2.7840 90.1 0. 0. 0. 0. 0. 0. | 3.71E-4 -2.15E-5 -2.65E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | kalGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) -2.127829e6 | 0. 0. 0.5 1. 0.5 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. | -2014273.9 49.59 6.8375 217.0 0. 0. 0. 0. 0. 0. | 7.265E-4 -6.4E-5 -4.6E-8 0. 0. 0. 0. -5. | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | h2oGL 1 1 0 0 PMELT liquid endmember (Ghiorso et al, G3, 2002) 6.64e2 | 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0. 1. 0. | 67460.3 9.22 2.7750 0. 0. 0. 0. 0. 0. 0. | 1.086E-3 -6E-5 0E0 0. 0. 0. 0. -3.5 | 1d-16 0. 0. 0. 0. 0. 0. 0. 0. 0. <= fake shear modulus (small, but non-zero) | tichum 1 0 0 0 titanian clinhumite fit to bergell and spain data (ideal activ | 0. 8.5 0. 4. 0. 0. 0.5 0. 0. 0. 0. 0. 0. 0.5 0. | -9083448.366 426.3731707 19.49450 1036. -.1304500E-01 | -7373450. 0.0 -7100.150 0.0 0.0 | 0.5583505E-04 0.0 0.0 0.0 -.5583505E-03 | 2324507. -333.7500 4.0 cemnz EoS = 1 |ce-monazite from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 CE2O3(0.5)P2O5(0.5) GH = -2007471.839 S0 = 133.06 V0 = 4.516 c1 = 82.85 c2 = 0.123 c3 = -852650 end ymnz EoS = 1 |ce-monazite from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 Y2O3(0.5)P2O5(0.5) GH = -2019726.07 S0 = 107.29 V0 = 4.3 c1 = 78.05 c2 = 0.117 c3 = -924000 end xtm EoS = 1 |xenotime from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 Y2O3(0.5)P2O5(0.5) GH = -2038313.07 S0 = 107.29 V0 = 4.3 c1 = 78.05 c2 = 0.117 c3 = -924000 end yag EoS = 1 |Y-garnet from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 AL2O3(2.5)Y2O3(1.5) GH = -7347900 S0 = 305.164 V0 = 13.008 c1 = 465.841 c2 = 0.0442 c3 = -10884000 end OHAp EoS = 1 |hydrous apatite from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 CAO(5)P2O5(1.5)H2O(0.5) GH = -6855034.4 S0 = 390.4 V0 = 13.008 c1 = 387.8 c3 = -12700000.0 c5 = 1811.0 end alpL EoS = 2 |Al-P melt from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 AL2O3(0.5)P2O5(0.5) GH = -1715072.02 S0 = 90.8 V0 = 4.658 c1 = 1983.3 c2 = -1.65 c3 = 20607000.0 c4 = 0.000772 c5 = -29319.3 b8 = 4 end cepL EoS = 2 |Ce-P melt from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 CE2O3(0.5)P2O5(0.5) GH = -1912189.84 S0 = 133.06 V0 = 4.516 c1 = 82.85 c2 = 0.123 c3 = -852650.0 b8 = 4 end ypL EoS = 2 |Y-P melt from Spear and Pyle, 2010 converted to HP by Shrestha et al.,2019; entered by Felix Gervais, 4/23/2020 Y2O3(0.5)P2O5(0.5) GH = -1943024.51 S0 = 107.29 V0 = 4.3 c1 = 78.05 c2 = 0.117 c3 = -924000.0 b8 = 4 end